From b360fc6a288bebbeb0aec0fec1636bd15908e454 Mon Sep 17 00:00:00 2001 From: Vincent Delecroix Date: Thu, 27 Apr 2017 16:21:47 +0200 Subject: [PATCH 1/2] travis script and rundoctest.py --- .travis.yml | 15 +++++++++++---- tests/rundoctest.py | 23 +++++++++++++++++++++++ 2 files changed, 34 insertions(+), 4 deletions(-) create mode 100644 tests/rundoctest.py diff --git a/.travis.yml b/.travis.yml index 7c4fa3d7..1b6f7cdb 100644 --- a/.travis.yml +++ b/.travis.yml @@ -13,13 +13,20 @@ python: # non python dependencies before_install: - sudo apt-get -qq update - - sudo apt-get install libpari-dev pari-gp + - wget http://pari.math.u-bordeaux.fr/pub/pari/unix/pari-2.9.2.tar.gz + - tar xf pari-2.9.2.tar.gz + - cd pari-2.9.2/ + - ./Configure --prefix=/usr/ + - make gp + - sudo make install + - cd .. # command to install dependencies install: - pip install Cython - - pip install cysignals - - pip install git+https://github.com/defeo/cypari2 + - pip install cysignals --verbose - pip install . # command to run tests script: - - python -c "import doctest; import cypari2; doctest.testmod(cypari2, optionflags=doctest.ELLIPSIS|doctest.REPORT_NDIFF)" + - cd tests + - python rundoctest.py + diff --git a/tests/rundoctest.py b/tests/rundoctest.py new file mode 100644 index 00000000..909d9395 --- /dev/null +++ b/tests/rundoctest.py @@ -0,0 +1,23 @@ +#!/usr/bin/env python + +import sys +import cypari2 +import doctest + +failed = 0 +attempted = 0 +for mod in [cypari2.closure, cypari2.convert, cypari2.gen, + cypari2.handle_error, cypari2.pari_instance, cypari2.stack]: + + print("="*80) + print("Testing {}".format(mod.__name__)) + test = doctest.testmod(mod, optionflags=doctest.ELLIPSIS|doctest.REPORT_NDIFF) + failed += test.failed + attempted += test.attempted + +print("="*80) +print("Summary result for cypari2:") +print(" attempted = {}".format(attempted)) +print(" failed = {}".format(failed)) + +sys.exit(failed) From c83497b3bd174c033a720dfb8a0a82918676c709 Mon Sep 17 00:00:00 2001 From: Vincent Delecroix Date: Thu, 27 Apr 2017 17:52:28 +0200 Subject: [PATCH 2/2] convert Sage doctests to Python --- cypari2/closure.pyx | 90 +- cypari2/convert.pyx | 420 ++--- cypari2/gen.pyx | 3709 ++++++++++++++++++++----------------- cypari2/handle_error.pyx | 145 +- cypari2/pari_instance.pyx | 882 ++++----- 5 files changed, 2814 insertions(+), 2432 deletions(-) diff --git a/cypari2/closure.pyx b/cypari2/closure.pyx index 265948b0..f788776d 100644 --- a/cypari2/closure.pyx +++ b/cypari2/closure.pyx @@ -5,17 +5,19 @@ AUTHORS: - Jeroen Demeyer (2015-04-10): initial version, :trac:`18052`. -EXAMPLES:: - - sage: def the_answer(): - ....: return 42 - sage: f = pari(the_answer) - sage: f() - 42 - - sage: cube = pari(lambda i: i**3) - sage: cube.apply(range(10)) - [0, 1, 8, 27, 64, 125, 216, 343, 512, 729] +Examples: + +>>> def the_answer(): +... return 42 +>>> import cypari2 +>>> pari = cypari2.Pari() +>>> f = pari(the_answer) +>>> f() +42 + +>>> cube = pari(lambda i: i**3) +>>> cube.apply(range(10)) +[0, 1, 8, 27, 64, 125, 216, 343, 512, 729] """ #***************************************************************************** @@ -133,39 +135,39 @@ cpdef Gen objtoclosure(f): be interrupted. Therefore, it is advised to use this only for simple functions which do not take a long time. - EXAMPLES:: - - sage: from sage.libs.cypari2.closure import objtoclosure - sage: mul = objtoclosure(lambda i,j: i*j) - sage: mul - (v1,v2,v3,v4,v5)->call_python(v1,v2,v3,v4,v5,...) - sage: mul.type() - 't_CLOSURE' - sage: mul(6,9) - 54 - sage: def printme(x): - ....: print(x) - sage: objtoclosure(printme)('matid(2)') - [1, 0; 0, 1] - - Test various kinds of errors:: - - sage: mul(4) - Traceback (most recent call last): - ... - TypeError: () takes exactly 2 arguments (1 given) - sage: mul(None, None) - Traceback (most recent call last): - ... - ValueError: Cannot convert None to pari - sage: mul(*range(100)) - Traceback (most recent call last): - ... - PariError: call_python: too many parameters in user-defined function call - sage: mul([1], [2]) - Traceback (most recent call last): - ... - PariError: call_python: forbidden multiplication t_VEC (1 elts) * t_VEC (1 elts) + Examples: + + >>> from cypari2.closure import objtoclosure + >>> mul = objtoclosure(lambda i,j: i*j) + >>> mul + (v1,v2,v3,v4,v5)->call_python(v1,v2,v3,v4,v5,...) + >>> mul.type() + 't_CLOSURE' + >>> mul(6,9) + 54 + >>> def printme(x): + ... print(x) + >>> objtoclosure(printme)('matid(2)') + [1, 0; 0, 1] + + Test various kinds of errors: + + >>> mul(4) + Traceback (most recent call last): + ... + TypeError: () takes exactly 2 arguments (1 given) + >>> mul(None, None) + Traceback (most recent call last): + ... + ValueError: Cannot convert None to pari + >>> mul(*range(100)) + Traceback (most recent call last): + ... + PariError: call_python: too many parameters in user-defined function call + >>> mul([1], [2]) + Traceback (most recent call last): + ... + PariError: call_python: forbidden multiplication t_VEC (1 elts) * t_VEC (1 elts) """ sig_on() # Convert f to a t_INT containing the address of f diff --git a/cypari2/convert.pyx b/cypari2/convert.pyx index cee177d2..11d782af 100644 --- a/cypari2/convert.pyx +++ b/cypari2/convert.pyx @@ -65,26 +65,28 @@ cpdef integer_to_gen(x): Convert a Python ``int`` or ``long`` to a PARI ``gen`` of type ``t_INT``. - EXAMPLES:: - - sage: from sage.libs.cypari2.convert import integer_to_gen - sage: a = integer_to_gen(int(12345)); a; type(a) - 12345 - <... 'sage.libs.cypari2.gen.Gen'> - sage: a = integer_to_gen(long(12345)); a; type(a) - 12345 - <... 'sage.libs.cypari2.gen.Gen'> - sage: integer_to_gen(float(12345)) - Traceback (most recent call last): - ... - TypeError: integer_to_gen() needs an int or long argument, not float - - TESTS:: - - sage: for i in range(10000): - ....: x = 3**i - ....: if pari(long(x)) != pari(x): - ....: print(x) + Examples: + + >>> from cypari2.convert import integer_to_gen + >>> from cypari2 import Pari + >>> pari = Pari() + >>> a = integer_to_gen(int(12345)); a; type(a) + 12345 + <... 'cypari2.gen.Gen'> + >>> a = integer_to_gen(long(12345)); a; type(a) + 12345 + <... 'cypari2.gen.Gen'> + >>> integer_to_gen(float(12345)) + Traceback (most recent call last): + ... + TypeError: integer_to_gen() needs an int or long argument, not float + + Tests: + + >>> for i in range(10000): + ... x = 3**i + ... if pari(long(x)) != pari(x): + ... print(x) """ if isinstance(x, int): sig_on() @@ -104,63 +106,65 @@ cpdef gen_to_integer(Gen x): real ``t_COMPLEX``, a ``t_INTMOD`` or ``t_PADIC`` (which are lifted). - EXAMPLES:: - - sage: from sage.libs.cypari2.convert import gen_to_integer - sage: a = gen_to_integer(pari("12345")); a; type(a) - 12345 - <... 'int'> - sage: a = gen_to_integer(pari("10^30")); a; type(a) - 1000000000000000000000000000000L - <... 'long'> - sage: gen_to_integer(pari("19/5")) - 3 - sage: gen_to_integer(pari("1 + 0.0*I")) - 1 - sage: gen_to_integer(pari("3/2 + 0.0*I")) - 1 - sage: gen_to_integer(pari("Mod(-1, 11)")) - 10 - sage: gen_to_integer(pari("5 + O(5^10)")) - 5 - sage: gen_to_integer(pari("Pol(42)")) - 42 - sage: gen_to_integer(pari("x")) - Traceback (most recent call last): - ... - TypeError: unable to convert PARI object x of type t_POL to an integer - sage: gen_to_integer(pari("x + O(x^2)")) - Traceback (most recent call last): - ... - TypeError: unable to convert PARI object x + O(x^2) of type t_SER to an integer - sage: gen_to_integer(pari("1 + I")) - Traceback (most recent call last): - ... - TypeError: unable to convert PARI object 1 + I of type t_COMPLEX to an integer - - TESTS:: - - sage: for i in range(10000): - ....: x = 3**i - ....: if long(pari(x)) != long(x): - ....: print(x) - sage: gen_to_integer(pari("1.0 - 2^64")) - -18446744073709551615L - sage: gen_to_integer(pari("1 - 2^64")) - -18446744073709551615L - - Check some corner cases:: - - sage: for s in [1, -1]: - ....: for a in [1, 2**31, 2**32, 2**63, 2**64]: - ....: for b in [-1, 0, 1]: - ....: Nstr = str(s * (a + b)) - ....: N1 = gen_to_integer(pari(Nstr)) # Convert via PARI - ....: N2 = int(Nstr) # Convert via Python - ....: if N1 != N2: - ....: print(Nstr, N1, N2) - ....: if type(N1) is not type(N2): - ....: print(N1, type(N1), N2, type(N2)) + Examples: + + >>> from cypari2.convert import gen_to_integer + >>> from cypari2 import Pari + >>> pari = Pari() + >>> a = gen_to_integer(pari("12345")); a; type(a) + 12345 + <... 'int'> + >>> a = gen_to_integer(pari("10^30")); a; type(a) + 1000000000000000000000000000000L + <... 'long'> + >>> gen_to_integer(pari("19/5")) + 3 + >>> gen_to_integer(pari("1 + 0.0*I")) + 1 + >>> gen_to_integer(pari("3/2 + 0.0*I")) + 1 + >>> gen_to_integer(pari("Mod(-1, 11)")) + 10 + >>> gen_to_integer(pari("5 + O(5^10)")) + 5 + >>> gen_to_integer(pari("Pol(42)")) + 42 + >>> gen_to_integer(pari("x")) + Traceback (most recent call last): + ... + TypeError: unable to convert PARI object x of type t_POL to an integer + >>> gen_to_integer(pari("x + O(x^2)")) + Traceback (most recent call last): + ... + TypeError: unable to convert PARI object x + O(x^2) of type t_SER to an integer + >>> gen_to_integer(pari("1 + I")) + Traceback (most recent call last): + ... + TypeError: unable to convert PARI object 1 + I of type t_COMPLEX to an integer + + Tests: + + >>> for i in range(10000): + ... x = 3**i + ... if long(pari(x)) != long(x): + ... print(x) + >>> gen_to_integer(pari("1.0 - 2^64")) + -18446744073709551615L + >>> gen_to_integer(pari("1 - 2^64")) + -18446744073709551615L + + Check some corner cases: + + >>> for s in [1, -1]: + ... for a in [1, 2**31, 2**32, 2**63, 2**64]: + ... for b in [-1, 0, 1]: + ... Nstr = str(s * (a + b)) + ... N1 = gen_to_integer(pari(Nstr)) # Convert via PARI + ... N2 = int(Nstr) # Convert via Python + ... if N1 != N2: + ... print(Nstr, N1, N2) + ... if type(N1) is not type(N2): + ... print(N1, type(N1), N2, type(N2)) """ # First convert the input to a t_INT cdef GEN g = gtoi(x.g) @@ -440,136 +444,138 @@ cpdef gen_to_python(Gen z): - other PARI types are not supported and the function will raise a ``NotImplementedError`` - EXAMPLES:: - - sage: from sage.libs.cypari2.convert import gen_to_python - - Converting integers:: - - sage: z = pari('42'); z - 42 - sage: a = gen_to_python(z); a - 42 - sage: type(a) - <... 'int'> - - sage: a = gen_to_python(pari('3^50')) - sage: type(a) - <... 'long'> - - Converting rational numbers:: - - sage: z = pari('2/3'); z - 2/3 - sage: a = gen_to_python(z); a - Fraction(2, 3) - sage: type(a) - - - Converting real numbers (and infinities):: - - sage: z = pari('1.2'); z - 1.20000000000000 - sage: a = gen_to_python(z); a - 1.2 - sage: type(a) - <... 'float'> - - sage: z = pari('oo'); z - +oo - sage: a = gen_to_python(z); a - inf - sage: type(a) - <... 'float'> - - sage: z = pari('-oo'); z - -oo - sage: a = gen_to_python(z); a - -inf - sage: type(a) - <... 'float'> - - Converting complex numbers:: - - sage: z = pari('1 + I'); z - 1 + I - sage: a = gen_to_python(z); a - (1+1j) - sage: type(a) - <... 'complex'> - - sage: z = pari('2.1 + 3.03*I'); z - 2.10000000000000 + 3.03000000000000*I - sage: a = gen_to_python(z); a - (2.1+3.03j) - - Converting vectors:: - - sage: z1 = pari('Vecsmall([1,2,3])'); z1 - Vecsmall([1, 2, 3]) - sage: z2 = pari('[1, 3.4, [-5, 2], oo]'); z2 - [1, 3.40000000000000, [-5, 2], +oo] - sage: z3 = pari('[1, 5.2]~'); z3 - [1, 5.20000000000000]~ - sage: z1.type(), z2.type(), z3.type() - ('t_VECSMALL', 't_VEC', 't_COL') - - sage: a1 = gen_to_python(z1); a1 - [1, 2, 3] - sage: type(a1) - <... 'list'> - sage: map(type, a1) - [<... 'int'>, <... 'int'>, <... 'int'>] - - sage: a2 = gen_to_python(z2); a2 - [1, 3.4, [-5, 2], inf] - sage: type(a2) - <... 'list'> - sage: map(type, a2) - [<... 'int'>, <... 'float'>, <... 'list'>, <... 'float'>] - - sage: a3 = gen_to_python(z3); a3 - [1, 5.2] - sage: type(a3) - <... 'list'> - sage: map(type, a3) - [<... 'int'>, <... 'float'>] - - Converting matrices:: - - sage: z = pari('[1,2;3,4]') - sage: gen_to_python(z) - [[1, 2], [3, 4]] - - sage: z = pari('[[1, 3], [[2]]; 3, [4, [5, 6]]]') - sage: gen_to_python(z) - [[[1, 3], [[2]]], [3, [4, [5, 6]]]] - - Converting strings:: - - sage: z = pari('"Hello"') - sage: a = gen_to_python(z); a - 'Hello' - sage: type(a) - <... 'str'> - - Some currently unsupported types:: - - sage: z = pari('x') - sage: z.type() - 't_POL' - sage: gen_to_python(z) - Traceback (most recent call last): - ... - NotImplementedError: conversion not implemented for t_POL - - sage: z = pari('12 + O(2^13)') - sage: z.type() - 't_PADIC' - sage: gen_to_python(z) - Traceback (most recent call last): - ... - NotImplementedError: conversion not implemented for t_PADIC + Examples: + + >>> from cypari2 import Pari + >>> from cypari2.convert import gen_to_python + >>> pari = Pari() + + Converting integers: + + >>> z = pari('42'); z + 42 + >>> a = gen_to_python(z); a + 42 + >>> type(a) + <... 'int'> + + >>> a = gen_to_python(pari('3^50')) + >>> type(a) + <... 'long'> + + Converting rational numbers: + + >>> z = pari('2/3'); z + 2/3 + >>> a = gen_to_python(z); a + Fraction(2, 3) + >>> type(a) + + + Converting real numbers (and infinities): + + >>> z = pari('1.2'); z + 1.20000000000000 + >>> a = gen_to_python(z); a + 1.2 + >>> type(a) + <... 'float'> + + >>> z = pari('oo'); z + +oo + >>> a = gen_to_python(z); a + inf + >>> type(a) + <... 'float'> + + >>> z = pari('-oo'); z + -oo + >>> a = gen_to_python(z); a + -inf + >>> type(a) + <... 'float'> + + Converting complex numbers: + + >>> z = pari('1 + I'); z + 1 + I + >>> a = gen_to_python(z); a + (1+1j) + >>> type(a) + <... 'complex'> + + >>> z = pari('2.1 + 3.03*I'); z + 2.10000000000000 + 3.03000000000000*I + >>> a = gen_to_python(z); a + (2.1+3.03j) + + Converting vectors: + + >>> z1 = pari('Vecsmall([1,2,3])'); z1 + Vecsmall([1, 2, 3]) + >>> z2 = pari('[1, 3.4, [-5, 2], oo]'); z2 + [1, 3.40000000000000, [-5, 2], +oo] + >>> z3 = pari('[1, 5.2]~'); z3 + [1, 5.20000000000000]~ + >>> z1.type(), z2.type(), z3.type() + ('t_VECSMALL', 't_VEC', 't_COL') + + >>> a1 = gen_to_python(z1); a1 + [1, 2, 3] + >>> type(a1) + <... 'list'> + >>> map(type, a1) + [<... 'int'>, <... 'int'>, <... 'int'>] + + >>> a2 = gen_to_python(z2); a2 + [1, 3.4, [-5, 2], inf] + >>> type(a2) + <... 'list'> + >>> map(type, a2) + [<... 'int'>, <... 'float'>, <... 'list'>, <... 'float'>] + + >>> a3 = gen_to_python(z3); a3 + [1, 5.2] + >>> type(a3) + <... 'list'> + >>> map(type, a3) + [<... 'int'>, <... 'float'>] + + Converting matrices: + + >>> z = pari('[1,2;3,4]') + >>> gen_to_python(z) + [[1, 2], [3, 4]] + + >>> z = pari('[[1, 3], [[2]]; 3, [4, [5, 6]]]') + >>> gen_to_python(z) + [[[1, 3], [[2]]], [3, [4, [5, 6]]]] + + Converting strings: + + >>> z = pari('"Hello"') + >>> a = gen_to_python(z); a + 'Hello' + >>> type(a) + <... 'str'> + + Some currently unsupported types: + + >>> z = pari('x') + >>> z.type() + 't_POL' + >>> gen_to_python(z) + Traceback (most recent call last): + ... + NotImplementedError: conversion not implemented for t_POL + + >>> z = pari('12 + O(2^13)') + >>> z.type() + 't_PADIC' + >>> gen_to_python(z) + Traceback (most recent call last): + ... + NotImplementedError: conversion not implemented for t_PADIC """ cdef GEN g = z.g cdef long t = typ(g) diff --git a/cypari2/gen.pyx b/cypari2/gen.pyx index fa08eee7..c1f7757b 100644 --- a/cypari2/gen.pyx +++ b/cypari2/gen.pyx @@ -117,10 +117,12 @@ cdef class Gen(Gen_auto): to the first element, one can do ``x.new_ref(gel(x.g, 1))``. See :meth:`Gen.__getitem__` for an example of usage. - EXAMPLES:: + Examples: - sage: pari("[[1, 2], 3]")[0][1] # indirect doctest - 2 + >>> from cypari2 import Pari + >>> pari = Pari() + >>> pari("[[1, 2], 3]")[0][1] # indirect doctest + 2 """ cdef Gen x = Gen.__new__(Gen) x.g = g @@ -133,14 +135,16 @@ cdef class Gen(Gen_auto): OUTPUT: a Python string - EXAMPLES:: + Examples: - sage: pari('vector(5,i,i)') - [1, 2, 3, 4, 5] - sage: pari('[1,2;3,4]') - [1, 2; 3, 4] - sage: pari('Str(hello)') - "hello" + >>> from cypari2 import Pari + >>> pari = Pari() + >>> pari('vector(5,i,i)') + [1, 2, 3, 4, 5] + >>> pari('[1,2;3,4]') + [1, 2; 3, 4] + >>> pari('Str(hello)') + "hello" """ cdef char *c sig_on() @@ -164,14 +168,16 @@ cdef class Gen(Gen_auto): OUTPUT: a Python string - EXAMPLES:: + Examples: - sage: print(pari('vector(5,i,i)')) - [1, 2, 3, 4, 5] - sage: print(pari('[1,2;3,4]')) - [1, 2; 3, 4] - sage: print(pari('Str(hello)')) - hello + >>> from cypari2 import Pari + >>> pari = Pari() + >>> print(pari('vector(5,i,i)')) + [1, 2, 3, 4, 5] + >>> print(pari('[1,2;3,4]')) + [1, 2; 3, 4] + >>> print(pari('Str(hello)')) + hello """ # Use __repr__ except for strings if typ(self.g) == t_STR: @@ -182,10 +188,12 @@ cdef class Gen(Gen_auto): """ Return the hash of self, computed using PARI's hash_GEN(). - TESTS:: + Tests: - sage: type(pari('1 + 2.0*I').__hash__()) - <... 'int'> + >>> from cypari2 import Pari + >>> pari = Pari() + >>> type(pari('1 + 2.0*I').__hash__()) + <... 'int'> """ cdef long h sig_on() @@ -204,84 +212,87 @@ cdef class Gen(Gen_auto): - items of a ``t_STR`` are of type ``str`` - EXAMPLES: + Examples: - We can iterate over PARI vectors or columns:: + We can iterate over PARI vectors or columns: - sage: L = pari("vector(10,i,i^2)") - sage: L.__iter__() - - sage: [x for x in L] - [1, 4, 9, 16, 25, 36, 49, 64, 81, 100] - sage: list(L) - [1, 4, 9, 16, 25, 36, 49, 64, 81, 100] - sage: list(pari("vector(10,i,i^2)~")) - [1, 4, 9, 16, 25, 36, 49, 64, 81, 100] + >>> from cypari2 import Pari + >>> pari = Pari() + >>> L = pari("vector(10,i,i^2)") + >>> L.__iter__() + + >>> [x for x in L] + [1, 4, 9, 16, 25, 36, 49, 64, 81, 100] + >>> list(L) + [1, 4, 9, 16, 25, 36, 49, 64, 81, 100] + >>> list(pari("vector(10,i,i^2)~")) + [1, 4, 9, 16, 25, 36, 49, 64, 81, 100] - For polynomials, we iterate over the list of coefficients:: + For polynomials, we iterate over the list of coefficients: - sage: pol = pari("x^3 + 5/3*x"); list(pol) - [0, 5/3, 0, 1] + >>> pol = pari("x^3 + 5/3*x"); list(pol) + [0, 5/3, 0, 1] For power series or Laurent series, we get all coefficients starting - from the lowest degree term. This includes trailing zeros:: + from the lowest degree term. This includes trailing zeros: - sage: list(pari('x^2 + O(x^8)')) - [1, 0, 0, 0, 0, 0] - sage: list(pari('x^-2 + O(x^0)')) - [1, 0] + >>> list(pari('x^2 + O(x^8)')) + [1, 0, 0, 0, 0, 0] + >>> list(pari('x^-2 + O(x^0)')) + [1, 0] - For matrices, we iterate over the columns:: + For matrices, we iterate over the columns: - sage: M = pari.matrix(3,2,[1,4,2,5,3,6]); M - [1, 4; 2, 5; 3, 6] - sage: list(M) - [[1, 2, 3]~, [4, 5, 6]~] + >>> M = pari.matrix(3,2,[1,4,2,5,3,6]); M + [1, 4; 2, 5; 3, 6] + >>> list(M) + [[1, 2, 3]~, [4, 5, 6]~] - Other types are first converted to a vector using :meth:`Vec`:: + Other types are first converted to a vector using :meth:`Vec`: - sage: Q = pari('Qfb(1, 2, 3)') - sage: tuple(Q) - (1, 2, 3) - sage: Q.Vec() - [1, 2, 3] + >>> Q = pari('Qfb(1, 2, 3)') + >>> tuple(Q) + (1, 2, 3) + >>> Q.Vec() + [1, 2, 3] We get an error for "scalar" types or for types which cannot be - converted to a PARI vector:: + converted to a PARI vector: - sage: iter(pari(42)) - Traceback (most recent call last): - ... - TypeError: PARI object of type 't_INT' is not iterable - sage: iter(pari("x->x")) - Traceback (most recent call last): - ... - PariError: incorrect type in gtovec (t_CLOSURE) - - For ``t_VECSMALL``, the items are Python integers:: + >>> iter(pari(42)) + Traceback (most recent call last): + ... + TypeError: PARI object of type 't_INT' is not iterable + >>> iter(pari("x->x")) + Traceback (most recent call last): + ... + PariError: incorrect type in gtovec (t_CLOSURE) - sage: v = pari("Vecsmall([1,2,3,4,5,6])") - sage: list(v) - [1, 2, 3, 4, 5, 6] - sage: type(list(v)[0]).__name__ - 'int' + For ``t_VECSMALL``, the items are Python integers: - For ``t_STR``, the items are Python strings:: + >>> v = pari("Vecsmall([1,2,3,4,5,6])") + >>> list(v) + [1, 2, 3, 4, 5, 6] + >>> type(list(v)[0]).__name__ + 'int' - sage: v = pari('"hello"') - sage: list(v) - ['h', 'e', 'l', 'l', 'o'] + For ``t_STR``, the items are Python strings: - TESTS: + >>> v = pari('"hello"') + >>> list(v) + ['h', 'e', 'l', 'l', 'o'] - The following are deprecated:: + Test some deprecations: - sage: tuple(pari('3/5')) - doctest:...: DeprecationWarning: iterating a PARI 't_FRAC' is deprecated - (3, 5) - sage: tuple(pari('1 + 5*I')) - doctest:...: DeprecationWarning: iterating a PARI 't_COMPLEX' is deprecated - (1, 5) + >>> import warnings + >>> with warnings.catch_warnings(record=True) as w: + ... warnings.simplefilter('always') + ... tuple(pari('3/5')) + ... tuple(pari('1 + 5*I')) + ... assert len(w) == 2 + ... assert all(issubclass(u.category, DeprecationWarning) for u in w) + (3, 5) + (1, 5) """ cdef long i cdef long t = typ(self.g) @@ -320,46 +331,53 @@ cdef class Gen(Gen_auto): """ Convert ``self`` to a Python list with :class:`Gen` components. - EXAMPLES:: + Examples: + + A PARI vector becomes a Python list: - A PARI vector becomes a Python list:: + >>> from cypari2 import Pari + >>> pari = Pari() - sage: L = pari("vector(10,i,i^2)").list() - sage: L - [1, 4, 9, 16, 25, 36, 49, 64, 81, 100] - sage: type(L) - <... 'list'> - sage: type(L[0]) - + >>> L = pari("vector(10,i,i^2)").list() + >>> L + [1, 4, 9, 16, 25, 36, 49, 64, 81, 100] + >>> type(L) + <... 'list'> + >>> type(L[0]) + - For polynomials, list() returns the list of coefficients:: + For polynomials, list() returns the list of coefficients: - sage: pol = pari("x^3 + 5/3*x"); pol.list() - [0, 5/3, 0, 1] + >>> pol = pari("x^3 + 5/3*x"); pol.list() + [0, 5/3, 0, 1] For power series or Laurent series, we get all coefficients starting - from the lowest degree term. This includes trailing zeros:: + from the lowest degree term. This includes trailing zeros: - sage: pari('x^2 + O(x^8)').list() - [1, 0, 0, 0, 0, 0] - sage: pari('x^-2 + O(x^0)').list() - [1, 0] + >>> pari('x^2 + O(x^8)').list() + [1, 0, 0, 0, 0, 0] + >>> pari('x^-2 + O(x^0)').list() + [1, 0] - For matrices, we get a list of columns:: + For matrices, we get a list of columns: - sage: M = pari.matrix(3,2,[1,4,2,5,3,6]); M - [1, 4; 2, 5; 3, 6] - sage: M.list() - [[1, 2, 3]~, [4, 5, 6]~] + >>> M = pari.matrix(3,2,[1,4,2,5,3,6]); M + [1, 4; 2, 5; 3, 6] + >>> M.list() + [[1, 2, 3]~, [4, 5, 6]~] - TESTS: + Tests: For "scalar" types, this is deprecated. Currently, we get a - 1-element list containing ``self``:: + 1-element list containing ``self``: - sage: pari(42).list() - doctest:...: DeprecationWarning: calling list() on scalar PARI types is deprecated - [42] + >>> import warnings + >>> with warnings.catch_warnings(record=True) as w: + ... warnings.simplefilter('always') + ... pari(42).list() + ... assert len(w) == 1 + ... assert issubclass(w[0].category, DeprecationWarning) + [42] """ if is_scalar_t(typ(self.g)): # Deprecated, make this an error in the future @@ -370,14 +388,18 @@ cdef class Gen(Gen_auto): def __reduce__(self): """ - EXAMPLES:: + Examples: - sage: f = pari('x^3 - 3') - sage: loads(dumps(f)) == f - True - sage: f = pari('"hello world"') - sage: loads(dumps(f)) == f - True + >>> from cypari2 import Pari + >>> pari = Pari() + >>> from pickle import loads, dumps + + >>> f = pari('x^3 - 3') + >>> loads(dumps(f)) == f + True + >>> f = pari('"hello world"') + >>> loads(dumps(f)) == f + True """ s = repr(self) return (objtogen, (s,)) @@ -386,16 +408,19 @@ cdef class Gen(Gen_auto): """ Return ``left`` plus ``right``. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(15) + pari(6) - 21 - sage: pari("x^3+x^2+x+1") + pari("x^2") - x^3 + 2*x^2 + x + 1 - sage: 2e20 + pari("1e20") - 3.00000000000000 E20 - sage: -2 + pari(3) - 1 + >>> pari(15) + pari(6) + 21 + >>> pari("x^3+x^2+x+1") + pari("x^2") + x^3 + 2*x^2 + x + 1 + >>> 2e20 + pari("1e20") + 3.00000000000000 E20 + >>> -2 + pari(3) + 1 """ cdef Gen t0, t1 try: @@ -410,16 +435,19 @@ cdef class Gen(Gen_auto): """ Return ``left`` minus ``right``. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(15) - pari(6) - 9 - sage: pari("x^3+x^2+x+1") - pari("x^2") - x^3 + x + 1 - sage: 2e20 - pari("1e20") - 1.00000000000000 E20 - sage: -2 - pari(3) - -5 + >>> pari(15) - pari(6) + 9 + >>> pari("x^3+x^2+x+1") - pari("x^2") + x^3 + x + 1 + >>> 2e20 - pari("1e20") + 1.00000000000000 E20 + >>> -2 - pari(3) + -5 """ cdef Gen t0, t1 try: @@ -466,14 +494,17 @@ cdef class Gen(Gen_auto): OUTPUT: pari gen - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: n = pari(5) - sage: n._add_one() - 6 - sage: n = pari('x^3') - sage: n._add_one() - x^3 + 1 + >>> n = pari(5) + >>> n._add_one() + 6 + >>> n = pari('x^3') + >>> n._add_one() + x^3 + 1 """ sig_on() return new_gen(gaddsg(1, self.g)) @@ -482,16 +513,19 @@ cdef class Gen(Gen_auto): """ Return ``left`` modulo ``right``. - EXAMPLES:: + Examples: - sage: pari(15) % pari(6) - 3 - sage: pari("x^3+x^2+x+1") % pari("x^2") - x + 1 - sage: pari(-2) % 3 - 1 - sage: -2 % pari(3) - 1 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(15) % pari(6) + 3 + >>> pari("x^3+x^2+x+1") % pari("x^2") + x + 1 + >>> pari(-2) % 3 + 1 + >>> -2 % pari(3) + 1 """ cdef Gen t0, t1 try: @@ -507,18 +541,21 @@ cdef class Gen(Gen_auto): Return ``left`` to the power ``right`` (if ``m`` is ``None``) or ``Mod(left, m)^right`` if ``m`` is not ``None``. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(5) ** pari(3) - 125 - sage: pari("x-1") ** 3 - x^3 - 3*x^2 + 3*x - 1 - sage: pow(pari(5), pari(28), int(29)) - Mod(1, 29) - sage: 2 ** pari(-5) - 1/32 - sage: pari(2) ** -5 - 1/32 + >>> pari(5) ** pari(3) + 125 + >>> pari("x-1") ** 3 + x^3 - 3*x^2 + 3*x - 1 + >>> pow(pari(5), pari(28), int(29)) + Mod(1, 29) + >>> 2 ** pari(-5) + 1/32 + >>> pari(2) ** -5 + 1/32 """ cdef Gen t0, t1 try: @@ -540,18 +577,21 @@ cdef class Gen(Gen_auto): Divide ``self`` by `2^n` (truncating or not, depending on the input type). - EXAMPLES:: + Examples: - sage: pari(25) >> 3 - 3 - sage: pari(25/2) >> 2 - 25/8 - sage: pari("x") >> 3 - 1/8*x - sage: pari(1.0) >> 100 - 7.88860905221012 E-31 - sage: 33 >> pari(2) - 8 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(25) >> 3 + 3 + >>> pari('25/2') >> 2 + 25/8 + >>> pari("x") >> 3 + 1/8*x + >>> pari(1.0) >> 100 + 7.88860905221012 E-31 + >>> 33 >> pari(2) + 8 """ cdef Gen t0 = objtogen(self) sig_on() @@ -561,18 +601,21 @@ cdef class Gen(Gen_auto): """ Multiply ``self`` by `2^n`. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(25) << 3 - 200 - sage: pari(25/32) << 2 - 25/8 - sage: pari("x") << 3 - 8*x - sage: pari(1.0) << 100 - 1.26765060022823 E30 - sage: 33 << pari(2) - 132 + >>> pari(25) << 3 + 200 + >>> pari("25/32") << 2 + 25/8 + >>> pari("x") << 3 + 8*x + >>> pari(1.0) << 100 + 1.26765060022823 E30 + >>> 33 << pari(2) + 132 """ cdef Gen t0 = objtogen(self) sig_on() @@ -586,22 +629,25 @@ cdef class Gen(Gen_auto): """ Return the PARI attribute with the given name. - EXAMPLES:: + Examples: - sage: K = pari("nfinit(x^2 - x - 1)") - sage: K.getattr("pol") - x^2 - x - 1 - sage: K.getattr("disc") - 5 + >>> from cypari2 import Pari + >>> pari = Pari() - sage: K.getattr("reg") - Traceback (most recent call last): - ... - PariError: _.reg: incorrect type in reg (t_VEC) - sage: K.getattr("zzz") - Traceback (most recent call last): - ... - PariError: not a function in function call + >>> K = pari("nfinit(x^2 - x - 1)") + >>> K.getattr("pol") + x^2 - x - 1 + >>> K.getattr("disc") + 5 + + >>> K.getattr("reg") + Traceback (most recent call last): + ... + PariError: _.reg: incorrect type in reg (t_VEC) + >>> K.getattr("zzz") + Traceback (most recent call last): + ... + PariError: not a function in function call """ t = "_." + attr sig_on() @@ -611,16 +657,19 @@ cdef class Gen(Gen_auto): """ Given an INTMOD or POLMOD ``Mod(a,m)``, return the modulus `m`. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(4).Mod(5).mod() - 5 - sage: pari("Mod(x, x*y)").mod() - y*x - sage: pari("[Mod(4,5)]").mod() - Traceback (most recent call last): - ... - TypeError: Not an INTMOD or POLMOD in mod() + >>> pari(4).Mod(5).mod() + 5 + >>> pari("Mod(x, x*y)").mod() + y*x + >>> pari("[Mod(4,5)]").mod() + Traceback (most recent call last): + ... + TypeError: Not an INTMOD or POLMOD in mod() """ if typ(self.g) != t_INTMOD and typ(self.g) != t_POLMOD: raise TypeError("Not an INTMOD or POLMOD in mod()") @@ -636,10 +685,13 @@ cdef class Gen(Gen_auto): r''' This function is :emphasis:`deprecated`, use :meth:`.polredbest` instead. - TESTS:: + Tests: - sage: pari('x^4 + 8').polred(2) - [1, x - 1; 1/2*x^2 + 1, x^2 - 2*x + 3; -1/2*x^2 + 1, x^2 - 2*x + 3; 1/2*x^2, x^2 + 2; 1/4*x^3, x^4 + 2] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('x^4 + 8').polred(2) + [1, x - 1; 1/2*x^2 + 1, x^2 - 2*x + 3; -1/2*x^2 + 1, x^2 - 2*x + 3; 1/2*x^2, x^2 + 2; 1/4*x^3, x^4 + 2] ''' import warnings with warnings.catch_warnings(): @@ -655,29 +707,31 @@ cdef class Gen(Gen_auto): - ``self`` -- A PARI number field being the output of ``nfinit()``, ``bnfinit()`` or ``bnrinit()``. - EXAMPLES:: + Examples: - sage: x = pari('x') - sage: K = (x**4 - 4*x**2 + 1).bnfinit() - sage: bnr = K.bnrinit(2*x) - sage: bnr.nf_get_pol() - x^4 - 4*x^2 + 1 + >>> from cypari2 import Pari + >>> pari = Pari() - For relative number fields, this returns the relative - polynomial:: + >>> x = pari('x') + >>> K = (x**4 - 4*x**2 + 1).bnfinit() + >>> bnr = K.bnrinit(2*x) + >>> bnr.nf_get_pol() + x^4 - 4*x^2 + 1 - sage: y = pari.varhigher('y') - sage: L = K.rnfinit(y^2 - 5) - sage: L.nf_get_pol() - y^2 - 5 + For relative number fields, this returns the relative + polynomial: - An error is raised for invalid input:: + >>> y = pari.varhigher('y') + >>> L = K.rnfinit(y**2 - 5) + >>> L.nf_get_pol() + y^2 - 5 - sage: pari("[0]").nf_get_pol() - Traceback (most recent call last): - ... - PariError: incorrect type in pol (t_VEC) + An error is raised for invalid input: + >>> pari("[0]").nf_get_pol() + Traceback (most recent call last): + ... + PariError: incorrect type in pol (t_VEC) """ sig_on() return new_gen(member_pol(self.g)) @@ -691,12 +745,15 @@ cdef class Gen(Gen_auto): - ``self`` -- A PARI number field being the output of ``nfinit()``, ``bnfinit()`` or ``bnrinit()``. - EXAMPLES:: + Examples: - sage: x = pari('x') - sage: K = (x**4 - 4*x**2 + 1).nfinit() - sage: K.nf_get_diff() - [12, 0, 0, 0; 0, 12, 8, 0; 0, 0, 4, 0; 0, 0, 0, 4] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> x = pari('x') + >>> K = (x**4 - 4*x**2 + 1).nfinit() + >>> K.nf_get_diff() + [12, 0, 0, 0; 0, 12, 8, 0; 0, 0, 4, 0; 0, 0, 0, 4] """ sig_on() return new_gen(member_diff(self.g)) @@ -712,17 +769,20 @@ cdef class Gen(Gen_auto): - ``self`` -- A PARI number field being the output of ``nfinit()``, ``bnfinit()`` or ``bnrinit()``. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: x = pari('x') - sage: K = (x**4 - 4*x**2 + 1).nfinit() - sage: s = K.nf_get_sign(); s - [4, 0] - sage: type(s); type(s[0]) - <... 'list'> - <... 'int'> - sage: pari.polcyclo(15).nfinit().nf_get_sign() - [0, 4] + >>> x = pari('x') + >>> K = (x**4 - 4*x**2 + 1).nfinit() + >>> s = K.nf_get_sign(); s + [4, 0] + >>> type(s); type(s[0]) + <... 'list'> + <... 'int'> + >>> pari.polcyclo(15).nfinit().nf_get_sign() + [0, 4] """ cdef long r1 cdef long r2 @@ -744,12 +804,15 @@ cdef class Gen(Gen_auto): - ``self`` -- A PARI number field being the output of ``nfinit()``, ``bnfinit()`` or ``bnrinit()``. - EXAMPLES:: + Examples: - sage: x = pari('x') - sage: K = (x**4 - 4*x**2 + 1).nfinit() - sage: K.nf_get_zk() - [1, x, x^3 - 4*x, x^2 - 2] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> x = pari('x') + >>> K = (x**4 - 4*x**2 + 1).nfinit() + >>> K.nf_get_zk() + [1, x, x^3 - 4*x, x^2 - 2] """ sig_on() return new_gen(member_zk(self.g)) @@ -758,12 +821,15 @@ cdef class Gen(Gen_auto): """ Returns the class number of ``self``, a "big number field" (``bnf``). - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: x = pari('x') - sage: K = (x**2 + 65).bnfinit() - sage: K.bnf_get_no() - 8 + >>> x = pari('x') + >>> K = (x**2 + 65).bnfinit() + >>> K.bnf_get_no() + 8 """ sig_on() return new_gen(bnf_get_no(self.g)) @@ -775,12 +841,15 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a "big number field" (``bnf``). - EXAMPLES:: + Examples: - sage: x = pari('x') - sage: K = (x**2 + 65).bnfinit() - sage: K.bnf_get_cyc() - [4, 2] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> x = pari('x') + >>> K = (x**2 + 65).bnfinit() + >>> K.bnf_get_cyc() + [4, 2] """ sig_on() return new_gen(bnf_get_cyc(self.g)) @@ -792,12 +861,15 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a "big number field" (``bnf``). - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: x = pari('x') - sage: K = (x**2 + 65).bnfinit() - sage: G = K.bnf_get_gen(); G - [[3, 2; 0, 1], [2, 1; 0, 1]] + >>> x = pari('x') + >>> K = (x**2 + 65).bnfinit() + >>> G = K.bnf_get_gen(); G + [[3, 2; 0, 1], [2, 1; 0, 1]] """ sig_on() return new_gen(bnf_get_gen(self.g)) @@ -808,12 +880,15 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a "big number field" (``bnf``). - EXAMPLES:: + Examples: - sage: x = pari('x') - sage: K = (x**4 - 4*x**2 + 1).bnfinit() - sage: K.bnf_get_reg() - 2.66089858019037... + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> x = pari('x') + >>> K = (x**4 - 4*x**2 + 1).bnfinit() + >>> K.bnf_get_reg() + 2.66089858019037... """ sig_on() return new_gen(bnf_get_reg(self.g)) @@ -829,14 +904,17 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a PARI prime ideal (as returned by ``idealprimedec`` for example). - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: i = pari('i') - sage: K = (i**2 + 1).nfinit() - sage: F = K.idealprimedec(5); F - [[5, [-2, 1]~, 1, 1, [2, -1; 1, 2]], [5, [2, 1]~, 1, 1, [-2, -1; 1, -2]]] - sage: F[0].pr_get_p() - 5 + >>> i = pari('i') + >>> K = (i**2 + 1).nfinit() + >>> F = K.idealprimedec(5); F + [[5, [-2, 1]~, 1, 1, [2, -1; 1, 2]], [5, [2, 1]~, 1, 1, [-2, -1; 1, -2]]] + >>> F[0].pr_get_p() + 5 """ sig_on() return new_gen(pr_get_p(self.g)) @@ -848,16 +926,19 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a PARI prime ideal (as returned by ``idealprimedec`` for example). - EXAMPLES:: + Examples: - sage: i = pari('i') - sage: K = (i**2 + 1).nfinit() - sage: K.idealprimedec(2)[0].pr_get_e() - 2 - sage: K.idealprimedec(3)[0].pr_get_e() - 1 - sage: K.idealprimedec(5)[0].pr_get_e() - 1 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> i = pari('i') + >>> K = (i**2 + 1).nfinit() + >>> K.idealprimedec(2)[0].pr_get_e() + 2 + >>> K.idealprimedec(3)[0].pr_get_e() + 1 + >>> K.idealprimedec(5)[0].pr_get_e() + 1 """ cdef long e sig_on() @@ -872,16 +953,19 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a PARI prime ideal (as returned by ``idealprimedec`` for example). - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: i = pari('i') - sage: K = (i**2 + 1).nfinit() - sage: K.idealprimedec(2)[0].pr_get_f() - 1 - sage: K.idealprimedec(3)[0].pr_get_f() - 2 - sage: K.idealprimedec(5)[0].pr_get_f() - 1 + >>> i = pari('i') + >>> K = (i**2 + 1).nfinit() + >>> K.idealprimedec(2)[0].pr_get_f() + 1 + >>> K.idealprimedec(3)[0].pr_get_f() + 2 + >>> K.idealprimedec(5)[0].pr_get_f() + 1 """ cdef long f sig_on() @@ -897,16 +981,19 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a PARI prime ideal (as returned by ``idealprimedec`` for example). - EXAMPLES:: + Examples: - sage: i = pari('i') - sage: K = (i**2 + 1).nfinit() - sage: g = K.idealprimedec(2)[0].pr_get_gen(); g - [1, 1]~ - sage: g = K.idealprimedec(3)[0].pr_get_gen(); g - [3, 0]~ - sage: g = K.idealprimedec(5)[0].pr_get_gen(); g - [-2, 1]~ + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> i = pari('i') + >>> K = (i**2 + 1).nfinit() + >>> g = K.idealprimedec(2)[0].pr_get_gen(); g + [1, 1]~ + >>> g = K.idealprimedec(3)[0].pr_get_gen(); g + [3, 0]~ + >>> g = K.idealprimedec(5)[0].pr_get_gen(); g + [-2, 1]~ """ sig_on() return new_gen(pr_get_gen(self.g)) @@ -919,13 +1006,16 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a "big ideal" (``bid``) as returned by ``idealstar`` for example. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: i = pari('i') - sage: K = (i**2 + 1).bnfinit() - sage: J = K.idealstar(4*i + 2) - sage: J.bid_get_cyc() - [4, 2] + >>> i = pari('i') + >>> K = (i**2 + 1).bnfinit() + >>> J = K.idealstar(4*i + 2) + >>> J.bid_get_cyc() + [4, 2] """ sig_on() return new_gen(bid_get_cyc(self.g)) @@ -938,22 +1028,25 @@ cdef class Gen(Gen_auto): NOTE: ``self`` must be a "big ideal" (``bid``) with generators, as returned by ``idealstar`` with ``flag`` = 2. - EXAMPLES:: + Examples: - sage: i = pari('i') - sage: K = (i**2 + 1).bnfinit() - sage: J = K.idealstar(4*i + 2, 2) - sage: J.bid_get_gen() - [7, [-2, -1]~] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> i = pari('i') + >>> K = (i**2 + 1).bnfinit() + >>> J = K.idealstar(4*i + 2, 2) + >>> J.bid_get_gen() + [7, [-2, -1]~] We get an exception if we do not supply ``flag = 2`` to - ``idealstar``:: + ``idealstar``: - sage: J = K.idealstar(3) - sage: J.bid_get_gen() - Traceback (most recent call last): - ... - PariError: missing bid generators. Use idealstar(,,2) + >>> J = K.idealstar(3) + >>> J.bid_get_gen() + Traceback (most recent call last): + ... + PariError: missing bid generators. Use idealstar(,,2) """ sig_on() return new_gen(bid_get_gen(self.g)) @@ -964,91 +1057,94 @@ cdef class Gen(Gen_auto): Python. Note that this is *different* than the default behavior of the PARI/GP interpreter. - EXAMPLES:: - - sage: p = pari('1 + 2*x + 3*x^2') - sage: p[0] - 1 - sage: p[2] - 3 - sage: p[100] - 0 - sage: p[-1] - 0 - sage: q = pari('x^2 + 3*x^3 + O(x^6)') - sage: q[3] - 3 - sage: q[5] - 0 - sage: q[6] - Traceback (most recent call last): - ... - IndexError: index out of range - sage: m = pari('[1,2;3,4]') - sage: m[0] - [1, 3]~ - sage: m[1,0] - 3 - sage: l = pari('List([1,2,3])') - sage: l[1] - 2 - sage: s = pari('"hello, world!"') - sage: s[0] - 'h' - sage: s[4] - 'o' - sage: s[12] - '!' - sage: s[13] - Traceback (most recent call last): - ... - IndexError: index out of range - sage: v = pari('[1,2,3]') - sage: v[0] - 1 - sage: c = pari('Col([1,2,3])') - sage: c[1] - 2 - sage: sv = pari('Vecsmall([1,2,3])') - sage: sv[2] - 3 - sage: type(sv[2]) - <... 'int'> - sage: [pari('3/5')[i] for i in range(2)] - [3, 5] - sage: [pari('1 + 5*I')[i] for i in range(2)] - [1, 5] - sage: [pari('Qfb(1, 2, 3)')[i] for i in range(3)] - [1, 2, 3] - sage: pari(57)[0] - Traceback (most recent call last): - ... - TypeError: PARI object of type 't_INT' cannot be indexed - sage: m = pari("[[1,2;3,4],5]") ; m[0][1,0] - 3 - sage: v = pari(range(20)) - sage: v[2:5] - [2, 3, 4] - sage: v[:] - [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] - sage: v[10:] - [10, 11, 12, 13, 14, 15, 16, 17, 18, 19] - sage: v[:5] - [0, 1, 2, 3, 4] - sage: v[5:5] - [] - sage: v - [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] - sage: v[-1] - Traceback (most recent call last): - ... - IndexError: index out of range - sage: v[:-3] - [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16] - sage: v[5:] - [5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] - sage: pari([])[::] - [] + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> p = pari('1 + 2*x + 3*x^2') + >>> p[0] + 1 + >>> p[2] + 3 + >>> p[100] + 0 + >>> p[-1] + 0 + >>> q = pari('x^2 + 3*x^3 + O(x^6)') + >>> q[3] + 3 + >>> q[5] + 0 + >>> q[6] + Traceback (most recent call last): + ... + IndexError: index out of range + >>> m = pari('[1,2;3,4]') + >>> m[0] + [1, 3]~ + >>> m[1,0] + 3 + >>> l = pari('List([1,2,3])') + >>> l[1] + 2 + >>> s = pari('"hello, world!"') + >>> s[0] + 'h' + >>> s[4] + 'o' + >>> s[12] + '!' + >>> s[13] + Traceback (most recent call last): + ... + IndexError: index out of range + >>> v = pari('[1,2,3]') + >>> v[0] + 1 + >>> c = pari('Col([1,2,3])') + >>> c[1] + 2 + >>> sv = pari('Vecsmall([1,2,3])') + >>> sv[2] + 3 + >>> type(sv[2]) + <... 'int'> + >>> [pari('3/5')[i] for i in range(2)] + [3, 5] + >>> [pari('1 + 5*I')[i] for i in range(2)] + [1, 5] + >>> [pari('Qfb(1, 2, 3)')[i] for i in range(3)] + [1, 2, 3] + >>> pari(57)[0] + Traceback (most recent call last): + ... + TypeError: PARI object of type 't_INT' cannot be indexed + >>> m = pari("[[1,2;3,4],5]") ; m[0][1,0] + 3 + >>> v = pari(range(20)) + >>> v[2:5] + [2, 3, 4] + >>> v[:] + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] + >>> v[10:] + [10, 11, 12, 13, 14, 15, 16, 17, 18, 19] + >>> v[:5] + [0, 1, 2, 3, 4] + >>> v[5:5] + [] + >>> v + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] + >>> v[-1] + Traceback (most recent call last): + ... + IndexError: index out of range + >>> v[:-3] + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16] + >>> v[5:] + [5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] + >>> pari([])[::] + [] """ cdef Py_ssize_t i, j, k cdef object ind @@ -1180,72 +1276,73 @@ cdef class Gen(Gen_auto): - EXAMPLES:: - - sage: v = pari(range(10)) - sage: v - [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] - sage: v[0] = 10 - sage: w = pari([5,8,-20]) - sage: v - [10, 1, 2, 3, 4, 5, 6, 7, 8, 9] - sage: v[1] = w - sage: v - [10, [5, 8, -20], 2, 3, 4, 5, 6, 7, 8, 9] - sage: w[0] = -30 - sage: v - [10, [-30, 8, -20], 2, 3, 4, 5, 6, 7, 8, 9] - sage: t = v[1]; t[1] = 10 ; v - [10, [-30, 10, -20], 2, 3, 4, 5, 6, 7, 8, 9] - sage: v[1][0] = 54321 ; v - [10, [54321, 10, -20], 2, 3, 4, 5, 6, 7, 8, 9] - sage: w - [54321, 10, -20] - sage: v = pari([[[[0,1],2],3],4]) ; v[0][0][0][1] = 12 ; v - [[[[0, 12], 2], 3], 4] - sage: m = pari.matrix(2,2,range(4)) ; l = pari([5,6]) ; n = pari.matrix(2,2,[7,8,9,0]) ; m[1,0] = l ; l[1] = n ; m[1,0][1][1,1] = 1111 ; m - [0, 1; [5, [7, 8; 9, 1111]], 3] - sage: m = pari("[[1,2;3,4],5,6]") ; m[0][1,1] = 11 ; m - [[1, 2; 3, 11], 5, 6] - - Finally, we create a circular reference:: - - sage: v = pari([0]) - sage: w = pari([v]) - sage: v - [0] - sage: w - [[0]] - sage: v[0] = w + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> v = pari(range(10)) + >>> v + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] + >>> v[0] = 10 + >>> w = pari([5,8,-20]) + >>> v + [10, 1, 2, 3, 4, 5, 6, 7, 8, 9] + >>> v[1] = w + >>> v + [10, [5, 8, -20], 2, 3, 4, 5, 6, 7, 8, 9] + >>> w[0] = -30 + >>> v + [10, [-30, 8, -20], 2, 3, 4, 5, 6, 7, 8, 9] + >>> t = v[1]; t[1] = 10 ; v + [10, [-30, 10, -20], 2, 3, 4, 5, 6, 7, 8, 9] + >>> v[1][0] = 54321 ; v + [10, [54321, 10, -20], 2, 3, 4, 5, 6, 7, 8, 9] + >>> w + [54321, 10, -20] + >>> v = pari([[[[0,1],2],3],4]) ; v[0][0][0][1] = 12 ; v + [[[[0, 12], 2], 3], 4] + >>> m = pari.matrix(2,2,range(4)) ; l = pari([5,6]) ; n = pari.matrix(2,2,[7,8,9,0]) ; m[1,0] = l ; l[1] = n ; m[1,0][1][1,1] = 1111 ; m + [0, 1; [5, [7, 8; 9, 1111]], 3] + >>> m = pari("[[1,2;3,4],5,6]") ; m[0][1,1] = 11 ; m + [[1, 2; 3, 11], 5, 6] + + Finally, we create a circular reference: + + >>> v = pari([0]) + >>> w = pari([v]) + >>> v + [0] + >>> w + [[0]] + >>> v[0] = w Now there is a circular reference. Accessing v[0] will crash Sage. - :: - - sage: s=pari.vector(2,[0,0]) - sage: s[:1] - [0] - sage: s[:1]=[1] - sage: s - [1, 0] - sage: type(s[0]) - - sage: s = pari(range(20)) ; s - [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] - sage: s[0:10:2] = range(50,55) ; s - [50, 1, 51, 3, 52, 5, 53, 7, 54, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] - sage: s[10:20:3] = range(100,150) ; s - [50, 1, 51, 3, 52, 5, 53, 7, 54, 9, 100, 11, 12, 101, 14, 15, 102, 17, 18, 103] - - TESTS:: - - sage: v = pari(range(10)) ; v - [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] - sage: v[:] = [20..29] - sage: v - [20, 21, 22, 23, 24, 25, 26, 27, 28, 29] - sage: type(v[0]) - + >>> s = pari.vector(2,[0,0]) + >>> s[:1] + [0] + >>> s[:1]=[1] + >>> s + [1, 0] + >>> type(s[0]) + + >>> s = pari(range(20)) ; s + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] + >>> s[0:10:2] = range(50,55) ; s + [50, 1, 51, 3, 52, 5, 53, 7, 54, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19] + >>> s[10:20:3] = range(100,150) ; s + [50, 1, 51, 3, 52, 5, 53, 7, 54, 9, 100, 11, 12, 101, 14, 15, 102, 17, 18, 103] + + Tests: + + >>> v = pari(range(10)) ; v + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] + >>> v[:] = range(20, 30) + >>> v + [20, 21, 22, 23, 24, 25, 26, 27, 28, 29] + >>> type(v[0]) + """ cdef Py_ssize_t i, j, step cdef Gen x = objtogen(y) @@ -1304,61 +1401,64 @@ cdef class Gen(Gen_auto): """ Compare ``left`` and ``right`` using ``op``. - EXAMPLES:: - - sage: a = pari(5) - sage: b = 10 - sage: a < b - True - sage: a <= b - True - sage: a <= 5 - True - sage: a > b - False - sage: a >= b - False - sage: a >= pari(10) - False - sage: a == 5 - True - sage: a is 5 - False - - sage: pari(2.5) > None - True - sage: pari(3) == pari(3) - True - sage: pari('x^2 + 1') == pari('I-1') - False - sage: pari(I) == pari(I) - True + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> a = pari(5) + >>> b = 10 + >>> a < b + True + >>> a <= b + True + >>> a <= 5 + True + >>> a > b + False + >>> a >= b + False + >>> a >= pari(10) + False + >>> a == 5 + True + >>> a is 5 + False + + >>> pari(2.5) > None + True + >>> pari(3) == pari(3) + True + >>> pari('x^2 + 1') == pari('I-1') + False + >>> pari(I) == pari(I) + True This does not define a total order. An error is raised when - applying inequality operators to non-ordered types:: + applying inequality operators to non-ordered types: - sage: pari("Mod(1,3)") <= pari("Mod(2,3)") - Traceback (most recent call last): - ... - PariError: forbidden comparison t_INTMOD , t_INTMOD - sage: pari("[0]") <= pari("0") - Traceback (most recent call last): - ... - PariError: forbidden comparison t_VEC (1 elts) , t_INT + >>> pari("Mod(1,3)") <= pari("Mod(2,3)") + Traceback (most recent call last): + ... + PariError: forbidden comparison t_INTMOD , t_INTMOD + >>> pari("[0]") <= pari("0") + Traceback (most recent call last): + ... + PariError: forbidden comparison t_VEC (1 elts) , t_INT - TESTS: + Tests: - Check that :trac:`16127` has been fixed:: + Check that :trac:`16127` has been fixed: - sage: pari('1/2') < pari('1/3') - False - sage: pari(1) < pari('1/2') - False + >>> pari('1/2') < pari('1/3') + False + >>> pari(1) < pari('1/2') + False - sage: pari('O(x)') == 0 - True - sage: pari('O(2)') == 0 - True + >>> pari('O(x)') == 0 + True + >>> pari('O(2)') == 0 + True """ cdef Gen t0, t1 try: @@ -1400,49 +1500,53 @@ cdef class Gen(Gen_auto): rationals or reals, this does not correspond to the natural ordering. - EXAMPLES:: - - sage: cmp(pari(5), 5) - 0 - sage: cmp(pari(5), 10) - -1 - sage: cmp(pari(2.5), None) - 1 - sage: cmp(pari(3), pari(3)) - 0 - sage: cmp(pari('x^2 + 1'), pari('I-1')) - 1 - sage: cmp(pari(I), pari(I)) - 0 - - Beware when comparing rationals or reals:: - - sage: cmp(pari('2/3'), pari('2/5')) - -1 - sage: two = pari('2.000000000000000000000000') - sage: cmp(two, pari(1.0)) - 1 - sage: cmp(two, pari(2.0)) - 1 - sage: cmp(two, pari(3.0)) - 1 + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> cmp(pari(5), 5) + 0 + >>> cmp(pari(5), 10) + -1 + >>> cmp(pari(2.5), None) + 1 + >>> cmp(pari(3), pari(3)) + 0 + >>> cmp(pari('x^2 + 1'), pari('I-1')) + 1 + >>> I = pari('I') + >>> cmp(I, I) + 0 + + Beware when comparing rationals or reals: + + >>> cmp(pari('2/3'), pari('2/5')) + -1 + >>> two = pari('2.000000000000000000000000') + >>> cmp(two, pari(1.0)) + 1 + >>> cmp(two, pari(2.0)) + 1 + >>> cmp(two, pari(3.0)) + 1 Since :trac:`17026`, different elements with the same string - representation can be distinguished by ``cmp()``:: - - sage: a = pari(0); a - 0 - sage: b = pari("0*ffgen(ffinit(29, 10))"); b - 0 - sage: cmp(a, b) - -1 - - sage: x = pari("x"); x - x - sage: y = pari("ffgen(ffinit(3, 5))"); y - x - sage: cmp(x, y) - 1 + representation can be distinguished by ``cmp()``: + + >>> a = pari(0); a + 0 + >>> b = pari("0*ffgen(ffinit(29, 10))"); b + 0 + >>> cmp(a, b) + -1 + + >>> x = pari("x"); x + x + >>> y = pari("ffgen(ffinit(3, 5))"); y + x + >>> cmp(x, y) + 1 """ sig_on() cdef int r = cmp_universal(self.g, other.g) @@ -1457,20 +1561,23 @@ cdef class Gen(Gen_auto): """ Return the hexadecimal digits of self in lower case. - EXAMPLES:: - - sage: print(hex(pari(0))) - 0 - sage: print(hex(pari(15))) - f - sage: print(hex(pari(16))) - 10 - sage: print(hex(pari(16938402384092843092843098243))) - 36bb1e3929d1a8fe2802f083 - sage: print(hex(long(16938402384092843092843098243))) - 0x36bb1e3929d1a8fe2802f083L - sage: print(hex(pari(-16938402384092843092843098243))) - -36bb1e3929d1a8fe2802f083 + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> print(hex(pari(0))) + 0 + >>> print(hex(pari(15))) + f + >>> print(hex(pari(16))) + 10 + >>> print(hex(pari(16938402384092843092843098243))) + 36bb1e3929d1a8fe2802f083 + >>> print(hex(long(16938402384092843092843098243))) + 0x36bb1e3929d1a8fe2802f083L + >>> print(hex(pari(-16938402384092843092843098243))) + -36bb1e3929d1a8fe2802f083 """ cdef GEN x cdef long lx @@ -1517,31 +1624,34 @@ cdef class Gen(Gen_auto): If the number is too large to fit into a Python ``int``, a Python ``long`` is returned instead. - EXAMPLES:: - - sage: int(pari(0)) - 0 - sage: int(pari(10)) - 10 - sage: int(pari(-10)) - -10 - sage: int(pari(123456789012345678901234567890)) - 123456789012345678901234567890L - sage: int(pari(-123456789012345678901234567890)) - -123456789012345678901234567890L - sage: int(pari(2**31-1)) - 2147483647 - sage: int(pari(-2**31)) - -2147483648 - sage: int(pari("Pol(10)")) - 10 - sage: int(pari("Mod(2, 7)")) - 2 - sage: int(pari(2**63-1)) - 9223372036854775807L # 32-bit - 9223372036854775807 # 64-bit - sage: int(pari(2**63+2)) - 9223372036854775810L + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> int(pari(0)) + 0 + >>> int(pari(10)) + 10 + >>> int(pari(-10)) + -10 + >>> int(pari(123456789012345678901234567890)) + 123456789012345678901234567890L + >>> int(pari(-123456789012345678901234567890)) + -123456789012345678901234567890L + >>> int(pari(2**31-1)) + 2147483647 + >>> int(pari(-2**31)) + -2147483648 + >>> int(pari("Pol(10)")) + 10 + >>> int(pari("Mod(2, 7)")) + 2 + + >>> int(pari(2**63-1)) == 9223372036854775807 + True + >>> int(pari(2**63+2)) == 9223372036854775810 + True """ return gen_to_integer(self) @@ -1550,21 +1660,24 @@ cdef class Gen(Gen_auto): Coerce ``self`` (which must be a :class:`Gen` of type ``t_INT``) to a Python integer. - EXAMPLES:: - - >>> from operator import index - >>> i = pari(2) - >>> index(i) - 2 - >>> L = [0, 1, 2, 3, 4] - >>> L[i] - 2 - >>> print(index(pari("2^100"))) - 1267650600228229401496703205376 - >>> index(pari("2.5")) - Traceback (most recent call last): - ... - TypeError: cannot coerce 2.50000000000000 (type t_REAL) to integer + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> from operator import index + >>> i = pari(2) + >>> index(i) + 2 + >>> L = [0, 1, 2, 3, 4] + >>> L[i] + 2 + >>> print(index(pari("2^100"))) + 1267650600228229401496703205376 + >>> index(pari("2.5")) + Traceback (most recent call last): + ... + TypeError: cannot coerce 2.50000000000000 (type t_REAL) to integer """ if typ(self.g) != t_INT: raise TypeError(f"cannot coerce {self!r} (type {self.type()}) to integer") @@ -1575,14 +1688,17 @@ cdef class Gen(Gen_auto): Return a Python list of the PARI gens. This object must be of type t_VECSMALL, and the resulting list contains python 'int's. - EXAMPLES:: + Examples: - sage: v=pari([1,2,3,10,102,10]).Vecsmall() - sage: w = v.python_list_small() - sage: w - [1, 2, 3, 10, 102, 10] - sage: type(w[0]) - <... 'int'> + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> v=pari([1,2,3,10,102,10]).Vecsmall() + >>> w = v.python_list_small() + >>> w + [1, 2, 3, 10, 102, 10] + >>> type(w[0]) + <... 'int'> """ cdef long n if typ(self.g) != t_VECSMALL: @@ -1602,19 +1718,22 @@ cdef class Gen(Gen_auto): elements of the input gen. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: v = pari([1,2,3,10,102,10]) - sage: w = v.python_list() - sage: w - [1, 2, 3, 10, 102, 10] - sage: type(w[0]) - - sage: pari("[1,2,3]").python_list() - [1, 2, 3] + >>> v = pari([1,2,3,10,102,10]) + >>> w = v.python_list() + >>> w + [1, 2, 3, 10, 102, 10] + >>> type(w[0]) + + >>> pari("[1,2,3]").python_list() + [1, 2, 3] - sage: pari("[1,2,3]~").python_list() - [1, 2, 3] + >>> pari("[1,2,3]~").python_list() + [1, 2, 3] """ cdef long n cdef Gen t @@ -1629,12 +1748,15 @@ cdef class Gen(Gen_auto): See :func:`~sage.libs.cypari.convert.gen_to_python` for more informations. - EXAMPLES:: + Examples: - sage: pari('1.2').python() - 1.2 - sage: pari('389/17').python() - Fraction(389, 17) + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('1.2').python() + 1.2 + >>> pari('389/17').python() + Fraction(389, 17) """ from .convert import gen_to_python return gen_to_python(self) @@ -1649,15 +1771,6 @@ cdef class Gen(Gen_auto): involve ``sage_eval`` See :func:`~sage.libs.pari.convert_sage.gen_to_sage` for more information. - - EXAMPLES:: - - sage: f = pari('(2/3)*x^3 + x - 5/7 + y'); f - 2/3*x^3 + x + (y - 5/7) - sage: var('x,y') - (x, y) - sage: f.sage({'x':x, 'y':y}) - 2/3*x^3 + x + y - 5/7 """ from sage.libs.pari.convert_sage import gen_to_sage return gen_to_sage(self, locals) @@ -1666,26 +1779,29 @@ cdef class Gen(Gen_auto): """ Convert ``self`` to a Python ``long``. - EXAMPLES:: - - sage: long(pari(0)) - 0L - sage: long(pari(10)) - 10L - sage: long(pari(-10)) - -10L - sage: long(pari(123456789012345678901234567890)) - 123456789012345678901234567890L - sage: long(pari(-123456789012345678901234567890)) - -123456789012345678901234567890L - sage: long(pari(2**31-1)) - 2147483647L - sage: long(pari(-2**31)) - -2147483648L - sage: long(pari("Pol(10)")) - 10L - sage: long(pari("Mod(2, 7)")) - 2L + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> long(pari(0)) + 0L + >>> long(pari(10)) + 10L + >>> long(pari(-10)) + -10L + >>> long(pari(123456789012345678901234567890)) + 123456789012345678901234567890L + >>> long(pari(-123456789012345678901234567890)) + -123456789012345678901234567890L + >>> long(pari(2**31-1)) + 2147483647L + >>> long(pari(-2**31)) + -2147483648L + >>> long(pari("Pol(10)")) + 10L + >>> long(pari("Mod(2, 7)")) + 2L """ x = gen_to_integer(self) if isinstance(x, long): @@ -1708,23 +1824,24 @@ cdef class Gen(Gen_auto): Return ``self`` as a Python ``complex`` value. - EXAMPLES:: + Examples: - sage: g = pari(-1.0)**(0.2); g - 0.809016994374947 + 0.587785252292473*I - sage: g.__complex__() - (0.8090169943749475+0.5877852522924731j) - sage: complex(g) - (0.8090169943749475+0.5877852522924731j) + >>> from cypari2 import Pari + >>> pari = Pari() - :: + >>> g = pari(-1.0)**(0.2); g + 0.809016994374947 + 0.587785252292473*I + >>> g.__complex__() + (0.8090169943749475+0.5877852522924731j) + >>> complex(g) + (0.8090169943749475+0.5877852522924731j) - sage: g = pari('Mod(3,5)'); g - Mod(3, 5) - sage: complex(g) - Traceback (most recent call last): - ... - PariError: incorrect type in greal/gimag (t_INTMOD) + >>> g = pari('Mod(3,5)'); g + Mod(3, 5) + >>> complex(g) + Traceback (most recent call last): + ... + PariError: incorrect type in greal/gimag (t_INTMOD) """ cdef double re, im sig_on() @@ -1735,17 +1852,20 @@ cdef class Gen(Gen_auto): def __nonzero__(self): """ - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari('1').__nonzero__() - True - sage: pari('x').__nonzero__() - True - sage: bool(pari(0)) - False - sage: a = pari('Mod(0,3)') - sage: a.__nonzero__() - False + >>> pari('1').__nonzero__() + True + >>> pari('x').__nonzero__() + True + >>> bool(pari(0)) + False + >>> a = pari('Mod(0,3)') + >>> a.__nonzero__() + False """ return not gequal0(self.g) @@ -1753,29 +1873,32 @@ cdef class Gen(Gen_auto): r""" Check whether `a` and `b` are equal using PARI's ``gequal``. - EXAMPLES:: - - sage: a = pari(1); b = pari(1.0); c = pari('"some_string"') - sage: a.gequal(a) - True - sage: b.gequal(b) - True - sage: c.gequal(c) - True - sage: a.gequal(b) - True - sage: a.gequal(c) - False - - WARNING: this relation is not transitive:: - - sage: a = pari('[0]'); b = pari(0); c = pari('[0,0]') - sage: a.gequal(b) - True - sage: b.gequal(c) - True - sage: a.gequal(c) - False + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> a = pari(1); b = pari(1.0); c = pari('"some_string"') + >>> a.gequal(a) + True + >>> b.gequal(b) + True + >>> c.gequal(c) + True + >>> a.gequal(b) + True + >>> a.gequal(c) + False + + WARNING: this relation is not transitive: + + >>> a = pari('[0]'); b = pari(0); c = pari('[0,0]') + >>> a.gequal(b) + True + >>> b.gequal(c) + True + >>> a.gequal(c) + False """ cdef Gen t0 = objtogen(b) sig_on() @@ -1787,18 +1910,21 @@ cdef class Gen(Gen_auto): r""" Check whether `a` is equal to zero. - EXAMPLES:: + Examples: - sage: pari(0).gequal0() - True - sage: pari(1).gequal0() - False - sage: pari(1e-100).gequal0() - False - sage: pari("0.0 + 0.0*I").gequal0() - True - sage: (pari('ffgen(3^20)')*0).gequal0() - True + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(0).gequal0() + True + >>> pari(1).gequal0() + False + >>> pari(1e-100).gequal0() + False + >>> pari("0.0 + 0.0*I").gequal0() + True + >>> (pari('ffgen(3^20)')*0).gequal0() + True """ sig_on() cdef int ret = gequal0(a.g) @@ -1809,23 +1935,26 @@ cdef class Gen(Gen_auto): r""" Check whether `a` is equal to the ``long int`` `b` using PARI's ``gequalsg``. - EXAMPLES:: - - sage: a = pari(1); b = pari(2.0); c = pari('3*matid(3)') - sage: a.gequal_long(1) - True - sage: a.gequal_long(-1) - False - sage: a.gequal_long(0) - False - sage: b.gequal_long(2) - True - sage: b.gequal_long(-2) - False - sage: c.gequal_long(3) - True - sage: c.gequal_long(-3) - False + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> a = pari(1); b = pari(2.0); c = pari('3*matid(3)') + >>> a.gequal_long(1) + True + >>> a.gequal_long(-1) + False + >>> a.gequal_long(0) + False + >>> b.gequal_long(2) + True + >>> b.gequal_long(-2) + False + >>> c.gequal_long(3) + True + >>> c.gequal_long(-3) + False """ sig_on() cdef int ret = gequalsg(b, a.g) @@ -1851,22 +1980,24 @@ cdef class Gen(Gen_auto): - ``bool`` - True or False - EXAMPLES:: - - sage: pari(9).isprime() - False - sage: pari(17).isprime() - True - sage: n = pari(561) # smallest Carmichael number - sage: n.isprime() # not just a pseudo-primality test! - False - sage: n.isprime(1) - False - sage: n.isprime(2) - False - sage: n = pari(2**31-1) - sage: n.isprime(1) - (True, [2, 3, 1; 3, 5, 1; 7, 3, 1; 11, 3, 1; 31, 2, 1; 151, 3, 1; 331, 3, 1]) + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + >>> pari(9).isprime() + False + >>> pari(17).isprime() + True + >>> n = pari(561) # smallest Carmichael number + >>> n.isprime() # not just a pseudo-primality test! + False + >>> n.isprime(1) + False + >>> n.isprime(2) + False + >>> n = pari(2**31-1) + >>> n.isprime(1) + (True, [2, 3, 1; 3, 5, 1; 7, 3, 1; 11, 3, 1; 31, 2, 1; 151, 3, 1; 331, 3, 1]) """ cdef GEN x sig_on() @@ -1902,15 +2033,17 @@ cdef class Gen(Gen_auto): (True, cert) where ``cert`` is a primality certificate. - EXAMPLES:: + Examples: - sage: pari(9).ispseudoprime() - False - sage: pari(17).ispseudoprime() - True - sage: n = pari(561) # smallest Carmichael number - sage: n.ispseudoprime(2) - False + >>> from cypari2 import Pari + >>> pari = Pari() + >>> pari(9).ispseudoprime() + False + >>> pari(17).ispseudoprime() + True + >>> n = pari(561) # smallest Carmichael number + >>> n.ispseudoprime(2) + False """ sig_on() cdef long t = ispseudoprime(self.g, flag) @@ -1936,18 +2069,20 @@ cdef class Gen(Gen_auto): - ``g`` - what it is a power of - EXAMPLES:: + Examples: - sage: pari(9).ispower() - (2, 3) - sage: pari(17).ispower() - (1, 17) - sage: pari(17).ispower(2) - (False, None) - sage: pari(17).ispower(1) - (1, 17) - sage: pari(2).ispower() - (1, 2) + >>> from cypari2 import Pari + >>> pari = Pari() + >>> pari(9).ispower() + (2, 3) + >>> pari(17).ispower() + (1, 17) + >>> pari(17).ispower(2) + (False, None) + >>> pari(17).ispower(1) + (1, 17) + >>> pari(2).ispower() + (1, 2) """ cdef int n cdef GEN x @@ -1993,16 +2128,18 @@ cdef class Gen(Gen_auto): If you don't need a proof that `p` is prime, you can use :meth:`ispseudoprimepower` instead. - EXAMPLES:: + Examples: - sage: pari(9).isprimepower() - (2, 3) - sage: pari(17).isprimepower() - (1, 17) - sage: pari(18).isprimepower() - (0, 18) - sage: pari(3**12345).isprimepower() - (12345, 3) + >>> from cypari2 import Pari + >>> pari = Pari() + >>> pari(9).isprimepower() + (2, 3) + >>> pari(17).isprimepower() + (1, 17) + >>> pari(18).isprimepower() + (0, 18) + >>> pari(3**12345).isprimepower() + (12345, 3) """ cdef GEN x cdef long n @@ -2033,13 +2170,16 @@ cdef class Gen(Gen_auto): and `k` the power. - Otherwise, `k = 0` and `p` is ``self``. - EXAMPLES:: + Examples: - sage: pari(3**12345).ispseudoprimepower() - (12345, 3) - sage: p = pari(2**1500 + 1465) # nextprime(2^1500) - sage: (p**11).ispseudoprimepower()[0] # very fast - 11 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(3**12345).ispseudoprimepower() + (12345, 3) + >>> p = pari(2**1500 + 1465) # nextprime(2^1500) + >>> (p**11).ispseudoprimepower()[0] # very fast + 11 """ cdef GEN x cdef long n @@ -2056,10 +2196,13 @@ cdef class Gen(Gen_auto): """ Return the maximum of the elements of the vector/matrix `x`. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari([1, '-5/3', 8.0]).vecmax() - 8.00000000000000 + >>> pari([1, '-5/3', 8.0]).vecmax() + 8.00000000000000 """ sig_on() return new_gen(vecmax(x.g)) @@ -2068,10 +2211,13 @@ cdef class Gen(Gen_auto): """ Return the minimum of the elements of the vector/matrix `x`. - EXAMPLES:: + Examples: - sage: pari([1, '-5/3', 8.0]).vecmin() - -5/3 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari([1, '-5/3', 8.0]).vecmin() + -5/3 """ sig_on() return new_gen(vecmin(x.g)) @@ -2091,31 +2237,34 @@ cdef class Gen(Gen_auto): A PARI column vector (type ``t_COL``) - EXAMPLES:: - - sage: pari(1.5).Col() - [1.50000000000000]~ - sage: pari([1,2,3,4]).Col() - [1, 2, 3, 4]~ - sage: pari('[1,2; 3,4]').Col() - [[1, 2], [3, 4]]~ - sage: pari('"CyPari"').Col() - ["C", "y", "P", "a", "r", "i"]~ - sage: pari('x + 3*x^3').Col() - [3, 0, 1, 0]~ - sage: pari('x + 3*x^3 + O(x^5)').Col() - [1, 0, 3, 0]~ - - We demonstate the `n` argument:: - - sage: pari([1,2,3,4]).Col(2) - [1, 2, 3, 4]~ - sage: pari([1,2,3,4]).Col(-2) - [1, 2, 3, 4]~ - sage: pari([1,2,3,4]).Col(6) - [1, 2, 3, 4, 0, 0]~ - sage: pari([1,2,3,4]).Col(-6) - [0, 0, 1, 2, 3, 4]~ + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(1.5).Col() + [1.50000000000000]~ + >>> pari([1,2,3,4]).Col() + [1, 2, 3, 4]~ + >>> pari('[1,2; 3,4]').Col() + [[1, 2], [3, 4]]~ + >>> pari('"CyPari"').Col() + ["C", "y", "P", "a", "r", "i"]~ + >>> pari('x + 3*x^3').Col() + [3, 0, 1, 0]~ + >>> pari('x + 3*x^3 + O(x^5)').Col() + [1, 0, 3, 0]~ + + We demonstate the `n` argument: + + >>> pari([1,2,3,4]).Col(2) + [1, 2, 3, 4]~ + >>> pari([1,2,3,4]).Col(-2) + [1, 2, 3, 4]~ + >>> pari([1,2,3,4]).Col(6) + [1, 2, 3, 4, 0, 0]~ + >>> pari([1,2,3,4]).Col(-6) + [0, 0, 1, 2, 3, 4]~ See also :meth:`Vec` (create a row vector) for more examples and :meth:`Colrev` (create a column in reversed order). @@ -2139,27 +2288,30 @@ cdef class Gen(Gen_auto): A PARI column vector (type ``t_COL``) - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(1.5).Colrev() - [1.50000000000000]~ - sage: pari([1,2,3,4]).Colrev() - [4, 3, 2, 1]~ - sage: pari('[1,2; 3,4]').Colrev() - [[3, 4], [1, 2]]~ - sage: pari('x + 3*x^3').Colrev() - [0, 1, 0, 3]~ + >>> pari(1.5).Colrev() + [1.50000000000000]~ + >>> pari([1,2,3,4]).Colrev() + [4, 3, 2, 1]~ + >>> pari('[1,2; 3,4]').Colrev() + [[3, 4], [1, 2]]~ + >>> pari('x + 3*x^3').Colrev() + [0, 1, 0, 3]~ - We demonstate the `n` argument:: + We demonstate the `n` argument: - sage: pari([1,2,3,4]).Colrev(2) - [4, 3, 2, 1]~ - sage: pari([1,2,3,4]).Colrev(-2) - [4, 3, 2, 1]~ - sage: pari([1,2,3,4]).Colrev(6) - [0, 0, 4, 3, 2, 1]~ - sage: pari([1,2,3,4]).Colrev(-6) - [4, 3, 2, 1, 0, 0]~ + >>> pari([1,2,3,4]).Colrev(2) + [4, 3, 2, 1]~ + >>> pari([1,2,3,4]).Colrev(-2) + [4, 3, 2, 1]~ + >>> pari([1,2,3,4]).Colrev(6) + [0, 0, 4, 3, 2, 1]~ + >>> pari([1,2,3,4]).Colrev(-6) + [4, 3, 2, 1, 0, 0]~ """ sig_on() # Create a non-reversed column vector @@ -2215,25 +2367,28 @@ cdef class Gen(Gen_auto): This function will not transform objects containing variables of higher priority than `v`. - EXAMPLES:: + Examples: - sage: pari(2).Ser() - 2 + O(x^16) - sage: pari('Mod(0, 7)').Ser() - Mod(0, 7)*x^15 + O(x^16) + >>> from cypari2 import Pari + >>> pari = Pari() - sage: x = pari([1, 2, 3, 4, 5]) - sage: x.Ser() - 1 + 2*x + 3*x^2 + 4*x^3 + 5*x^4 + O(x^16) - sage: f = x.Ser('v'); print(f) - 1 + 2*v + 3*v^2 + 4*v^3 + 5*v^4 + O(v^16) - sage: pari(1)/f - 1 - 2*v + v^2 + 6*v^5 - 17*v^6 + 16*v^7 - 5*v^8 + 36*v^10 - 132*v^11 + 181*v^12 - 110*v^13 + 25*v^14 + 216*v^15 + O(v^16) + >>> pari(2).Ser() + 2 + O(x^16) + >>> pari('Mod(0, 7)').Ser() + Mod(0, 7)*x^15 + O(x^16) - sage: pari('x^5').Ser(precision=20) - x^5 + O(x^25) - sage: pari('1/x').Ser(precision=1) - x^-1 + O(x^0) + >>> x = pari([1, 2, 3, 4, 5]) + >>> x.Ser() + 1 + 2*x + 3*x^2 + 4*x^3 + 5*x^4 + O(x^16) + >>> f = x.Ser('v'); print(f) + 1 + 2*v + 3*v^2 + 4*v^3 + 5*v^4 + O(v^16) + >>> pari(1)/f + 1 - 2*v + v^2 + 6*v^5 - 17*v^6 + 16*v^7 - 5*v^8 + 36*v^10 - 132*v^11 + 181*v^12 - 110*v^13 + 25*v^14 + 216*v^15 + O(v^16) + + >>> pari('x^5').Ser(precision=20) + x^5 + O(x^25) + >>> pari('1/x').Ser(precision=1) + x^-1 + O(x^0) """ if precision < 0: @@ -2265,19 +2420,22 @@ cdef class Gen(Gen_auto): string - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari([1,2,['abc',1]]).Str() - "[1, 2, [abc, 1]]" - sage: pari([1,1, 1.54]).Str() - "[1, 1, 1.54000000000000]" - sage: pari(1).Str() # 1 is automatically converted to string rep - "1" - sage: x = pari('x') # PARI variable "x" - sage: x.Str() # is converted to string rep. - "x" - sage: x.Str().type() - 't_STR' + >>> pari([1,2,['abc',1]]).Str() + "[1, 2, [abc, 1]]" + >>> pari([1,1, 1.54]).Str() + "[1, 1, 1.54000000000000]" + >>> pari(1).Str() # 1 is automatically converted to string rep + "1" + >>> x = pari('x') # PARI variable "x" + >>> x.Str() # is converted to string rep. + "x" + >>> x.Str().type() + 't_STR' """ cdef char* c sig_on() @@ -2305,18 +2463,21 @@ cdef class Gen(Gen_auto): - PARI string (type ``t_STR``) - EXAMPLES:: + Examples: - sage: pari('"~/subdir"').Strexpand() # random - "/home/johndoe/subdir" - sage: pari('"$SHELL"').Strexpand() # random - "/bin/bash" + >>> from cypari2 import Pari + >>> pari = Pari() - TESTS:: + >>> pari('"~/subdir"').Strexpand() + "..." + >>> pari('"$SHELL"').Strexpand() + "..." - sage: a = pari('"$HOME"') - sage: a.Strexpand() != a - True + Tests: + + >>> a = pari('"$HOME"') + >>> a.Strexpand() != a + True """ if typ(x.g) != t_VEC: x = list_of_Gens_to_Gen([x]) @@ -2337,17 +2498,20 @@ cdef class Gen(Gen_auto): - PARI string (type ``t_STR``) - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: v=pari('x^2') - sage: v.Strtex() - "x^2" - sage: v=pari(['1/x^2','x']) - sage: v.Strtex() - "\\frac{1}{x^2}x" - sage: v=pari(['1 + 1/x + 1/(y+1)','x-1']) - sage: v.Strtex() - "\\frac{ \\left(y\n + 2\\right) \\*x\n + \\left(y\n + 1\\right) }{ \\left(y\n + 1\\right) \\*x}x\n - 1" + >>> v = pari('x^2') + >>> v.Strtex() + "x^2" + >>> v = pari(['1/x^2','x']) + >>> v.Strtex() + "\\frac{1}{x^2}x" + >>> v = pari(['1 + 1/x + 1/(y+1)','x-1']) + >>> v.Strtex() + "\\frac{ \\left(y\n + 2\\right) \\*x\n + \\left(y\n + 1\\right) }{ \\left(y\n + 1\\right) \\*x}x\n - 1" """ if typ(x.g) != t_VEC: x = list_of_Gens_to_Gen([x]) @@ -2369,42 +2533,45 @@ cdef class Gen(Gen_auto): A PARI vector (type ``t_VEC``) - EXAMPLES:: - - sage: pari(1).Vec() - [1] - sage: pari('x^3').Vec() - [1, 0, 0, 0] - sage: pari('x^3 + 3*x - 2').Vec() - [1, 0, 3, -2] - sage: pari([1,2,3]).Vec() - [1, 2, 3] - sage: pari('[1, 2; 3, 4]').Vec() - [[1, 3]~, [2, 4]~] - sage: pari('"CyPari"').Vec() - ["C", "y", "P", "a", "r", "i"] - sage: pari('2*x^2 + 3*x^3 + O(x^5)').Vec() - [2, 3, 0] - sage: pari('2*x^-2 + 3*x^3 + O(x^5)').Vec() - [2, 0, 0, 0, 0, 3, 0] - - Note the different term ordering for polynomials and series:: - - sage: pari('1 + x + 3*x^3 + O(x^5)').Vec() - [1, 1, 0, 3, 0] - sage: pari('1 + x + 3*x^3').Vec() - [3, 0, 1, 1] - - We demonstate the `n` argument:: - - sage: pari([1,2,3,4]).Vec(2) - [1, 2, 3, 4] - sage: pari([1,2,3,4]).Vec(-2) - [1, 2, 3, 4] - sage: pari([1,2,3,4]).Vec(6) - [1, 2, 3, 4, 0, 0] - sage: pari([1,2,3,4]).Vec(-6) - [0, 0, 1, 2, 3, 4] + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(1).Vec() + [1] + >>> pari('x^3').Vec() + [1, 0, 0, 0] + >>> pari('x^3 + 3*x - 2').Vec() + [1, 0, 3, -2] + >>> pari([1,2,3]).Vec() + [1, 2, 3] + >>> pari('[1, 2; 3, 4]').Vec() + [[1, 3]~, [2, 4]~] + >>> pari('"CyPari"').Vec() + ["C", "y", "P", "a", "r", "i"] + >>> pari('2*x^2 + 3*x^3 + O(x^5)').Vec() + [2, 3, 0] + >>> pari('2*x^-2 + 3*x^3 + O(x^5)').Vec() + [2, 0, 0, 0, 0, 3, 0] + + Note the different term ordering for polynomials and series: + + >>> pari('1 + x + 3*x^3 + O(x^5)').Vec() + [1, 1, 0, 3, 0] + >>> pari('1 + x + 3*x^3').Vec() + [3, 0, 1, 1] + + We demonstate the `n` argument: + + >>> pari([1,2,3,4]).Vec(2) + [1, 2, 3, 4] + >>> pari([1,2,3,4]).Vec(-2) + [1, 2, 3, 4] + >>> pari([1,2,3,4]).Vec(6) + [1, 2, 3, 4, 0, 0] + >>> pari([1,2,3,4]).Vec(-6) + [0, 0, 1, 2, 3, 4] See also :meth:`Col` (create a column vector) and :meth:`Vecrev` (create a vector in reversed order). @@ -2428,33 +2595,36 @@ cdef class Gen(Gen_auto): A PARI vector (type ``t_VEC``) - EXAMPLES:: - - sage: pari(1).Vecrev() - [1] - sage: pari('x^3').Vecrev() - [0, 0, 0, 1] - sage: pari('x^3 + 3*x - 2').Vecrev() - [-2, 3, 0, 1] - sage: pari([1, 2, 3]).Vecrev() - [3, 2, 1] - sage: pari('Col([1, 2, 3])').Vecrev() - [3, 2, 1] - sage: pari('[1, 2; 3, 4]').Vecrev() - [[2, 4]~, [1, 3]~] - sage: pari('"CyPari"').Vecrev() - ["i", "r", "a", "P", "y", "C"] - - We demonstate the `n` argument:: - - sage: pari([1,2,3,4]).Vecrev(2) - [4, 3, 2, 1] - sage: pari([1,2,3,4]).Vecrev(-2) - [4, 3, 2, 1] - sage: pari([1,2,3,4]).Vecrev(6) - [0, 0, 4, 3, 2, 1] - sage: pari([1,2,3,4]).Vecrev(-6) - [4, 3, 2, 1, 0, 0] + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(1).Vecrev() + [1] + >>> pari('x^3').Vecrev() + [0, 0, 0, 1] + >>> pari('x^3 + 3*x - 2').Vecrev() + [-2, 3, 0, 1] + >>> pari([1, 2, 3]).Vecrev() + [3, 2, 1] + >>> pari('Col([1, 2, 3])').Vecrev() + [3, 2, 1] + >>> pari('[1, 2; 3, 4]').Vecrev() + [[2, 4]~, [1, 3]~] + >>> pari('"CyPari"').Vecrev() + ["i", "r", "a", "P", "y", "C"] + + We demonstate the `n` argument: + + >>> pari([1,2,3,4]).Vecrev(2) + [4, 3, 2, 1] + >>> pari([1,2,3,4]).Vecrev(-2) + [4, 3, 2, 1] + >>> pari([1,2,3,4]).Vecrev(6) + [0, 0, 4, 3, 2, 1] + >>> pari([1,2,3,4]).Vecrev(-6) + [4, 3, 2, 1, 0, 0] """ sig_on() return new_gen(_Vec_append(gtovecrev(x.g), gen_0, -n)) @@ -2474,27 +2644,30 @@ cdef class Gen(Gen_auto): A PARI vector of small integers (type ``t_VECSMALL``) - EXAMPLES:: + Examples: - sage: pari([1,2,3]).Vecsmall() - Vecsmall([1, 2, 3]) - sage: pari('"CyPari"').Vecsmall() - Vecsmall([67, 121, 80, 97, 114, 105]) - sage: pari(1234).Vecsmall() - Vecsmall([1234]) - sage: pari('x^2 + 2*x + 3').Vecsmall() - Vecsmall([1, 2, 3]) + >>> from cypari2 import Pari + >>> pari = Pari() - We demonstate the `n` argument:: + >>> pari([1,2,3]).Vecsmall() + Vecsmall([1, 2, 3]) + >>> pari('"CyPari"').Vecsmall() + Vecsmall([67, 121, 80, 97, 114, 105]) + >>> pari(1234).Vecsmall() + Vecsmall([1234]) + >>> pari('x^2 + 2*x + 3').Vecsmall() + Vecsmall([1, 2, 3]) - sage: pari([1,2,3]).Vecsmall(2) - Vecsmall([1, 2, 3]) - sage: pari([1,2,3]).Vecsmall(-2) - Vecsmall([1, 2, 3]) - sage: pari([1,2,3]).Vecsmall(6) - Vecsmall([1, 2, 3, 0, 0, 0]) - sage: pari([1,2,3]).Vecsmall(-6) - Vecsmall([0, 0, 0, 1, 2, 3]) + We demonstate the `n` argument: + + >>> pari([1,2,3]).Vecsmall(2) + Vecsmall([1, 2, 3]) + >>> pari([1,2,3]).Vecsmall(-2) + Vecsmall([1, 2, 3]) + >>> pari([1,2,3]).Vecsmall(6) + Vecsmall([1, 2, 3, 0, 0, 0]) + >>> pari([1,2,3]).Vecsmall(-6) + Vecsmall([0, 0, 0, 1, 2, 3]) """ sig_on() return new_gen(_Vec_append(gtovecsmall(x.g), 0, n)) @@ -2517,23 +2690,26 @@ cdef class Gen(Gen_auto): - ``bool`` - a Python bool - EXAMPLES:: - - sage: x = pari(6) - sage: x.bittest(0) - False - sage: x.bittest(1) - True - sage: x.bittest(2) - True - sage: x.bittest(3) - False - sage: pari(-3).bittest(0) - True - sage: pari(-3).bittest(1) - False - sage: [pari(-3).bittest(n) for n in range(10)] - [True, False, True, True, True, True, True, True, True, True] + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> x = pari(6) + >>> x.bittest(0) + False + >>> x.bittest(1) + True + >>> x.bittest(2) + True + >>> x.bittest(3) + False + >>> pari(-3).bittest(0) + True + >>> pari(-3).bittest(1) + False + >>> [pari(-3).bittest(n) for n in range(10)] + [True, False, True, True, True, True, True, True, True, True] """ sig_on() cdef long b = bittest(x.g, n) @@ -2554,13 +2730,16 @@ cdef class Gen(Gen_auto): - ``p`` - gen, of type t_INT - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: y = pari('11^-10 + 5*11^-7 + 11^-6 + O(11)') - sage: y.padicprime() - 11 - sage: y.padicprime().type() - 't_INT' + >>> y = pari('11^-10 + 5*11^-7 + 11^-6 + O(11)') + >>> y.padicprime() + 11 + >>> y.padicprime().type() + 't_INT' """ sig_on() return new_gen(gel(x.g, 2)) @@ -2615,20 +2794,23 @@ cdef class Gen(Gen_auto): - if estimate is True, return rounded version of x and error estimate in bits, both as gens. - EXAMPLES:: - - sage: pari('1.5').round() - 2 - sage: pari('1.5').round(True) - (2, -1) - sage: pari('1.5 + 2.1*I').round() - 2 + 2*I - sage: pari('1.0001').round(True) - (1, -14) - sage: pari('(2.4*x^2 - 1.7)/x').round() - (2*x^2 - 2)/x - sage: pari('(2.4*x^2 - 1.7)/x').truncate() - 2.40000000000000*x + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('1.5').round() + 2 + >>> pari('1.5').round(True) + (2, -1) + >>> pari('1.5 + 2.1*I').round() + 2 + 2*I + >>> pari('1.0001').round(True) + (1, -14) + >>> pari('(2.4*x^2 - 1.7)/x').round() + (2*x^2 - 2)/x + >>> pari('(2.4*x^2 - 1.7)/x').truncate() + 2.40000000000000*x """ cdef int n cdef long e @@ -2651,26 +2833,31 @@ cdef class Gen(Gen_auto): OUTPUT: int (a Python int) - EXAMPLES:: - - sage: pari('0').sizeword() - 2 - sage: pari('1').sizeword() - 3 - sage: pari('1000000').sizeword() - 3 - sage: pari('10^100').sizeword() - 13 # 32-bit - 8 # 64-bit - sage: pari(1.0).sizeword() - 4 # 32-bit - 3 # 64-bit - sage: pari('x').sizeword() - 9 - sage: pari('x^20').sizeword() - 66 - sage: pari('[x, I]').sizeword() - 20 + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('0').sizeword() + 2 + >>> pari('1').sizeword() + 3 + >>> pari('1000000').sizeword() + 3 + + >>> import sys + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> pari('10^100').sizeword() == (13 if bitness == '32' else 8) + True + >>> pari(1.0).sizeword() == (4 if bitness == '32' else 3) + True + + >>> pari('x').sizeword() + 9 + >>> pari('x^20').sizeword() + 66 + >>> pari('[x, I]').sizeword() + 20 """ return gsizeword(x.g) @@ -2686,11 +2873,15 @@ cdef class Gen(Gen_auto): OUTPUT: int (a Python int) - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari('1').sizebyte() - 12 # 32-bit - 24 # 64-bit + >>> import sys + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> pari('1').sizebyte() == (12 if bitness == '32' else 24) + True """ return gsizebyte(x.g) @@ -2728,26 +2919,29 @@ cdef class Gen(Gen_auto): - if estimate is True, return rounded version of x and error estimate in bits, both as gens. - EXAMPLES:: - - sage: pari('(x^2+1)/x').round() - (x^2 + 1)/x - sage: pari('(x^2+1)/x').truncate() - x - sage: pari('1.043').truncate() - 1 - sage: pari('1.043').truncate(True) - (1, -5) - sage: pari('1.6').truncate() - 1 - sage: pari('1.6').round() - 2 - sage: pari('1/3 + 2 + 3^2 + O(3^3)').truncate() - 34/3 - sage: pari('sin(x+O(x^10))').truncate() - 1/362880*x^9 - 1/5040*x^7 + 1/120*x^5 - 1/6*x^3 + x - sage: pari('sin(x+O(x^10))').round() # each coefficient has abs < 1 - x + O(x^10) + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('(x^2+1)/x').round() + (x^2 + 1)/x + >>> pari('(x^2+1)/x').truncate() + x + >>> pari('1.043').truncate() + 1 + >>> pari('1.043').truncate(True) + (1, -5) + >>> pari('1.6').truncate() + 1 + >>> pari('1.6').round() + 2 + >>> pari('1/3 + 2 + 3^2 + O(3^3)').truncate() + 34/3 + >>> pari('sin(x+O(x^10))').truncate() + 1/362880*x^9 - 1/5040*x^7 + 1/120*x^5 - 1/6*x^3 + x + >>> pari('sin(x+O(x^10))').round() # each coefficient has abs < 1 + x + O(x^10) """ cdef long e cdef Gen y @@ -2763,18 +2957,19 @@ cdef class Gen(Gen_auto): or a Laurent series (t_SER). If x is a different type, this will give a bogus number. - EXAMPLES:: + Examples: - sage: pari('1/x^2 + O(x^10)')._valp() - -2 - sage: pari('O(x^10)')._valp() - 10 - sage: pari('(1145234796 + O(3^10))/771966234')._valp() - -2 - sage: pari('O(2^10)')._valp() - 10 - sage: pari('x')._valp() # random - -35184372088832 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('1/x^2 + O(x^10)')._valp() + -2 + >>> pari('O(x^10)')._valp() + 10 + >>> pari('(1145234796 + O(3^10))/771966234')._valp() + -2 + >>> pari('O(2^10)')._valp() + 10 """ # This is a simple macro, so we don't need sig_on() return valp(x.g) @@ -2786,12 +2981,15 @@ cdef class Gen(Gen_auto): rational number. The argument `x` should be of type integer. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(18).bernfrac() - 43867/798 - sage: [pari(n).bernfrac() for n in range(10)] - [1, -1/2, 1/6, 0, -1/30, 0, 1/42, 0, -1/30, 0] + >>> pari(18).bernfrac() + 43867/798 + >>> [pari(n).bernfrac() for n in range(10)] + [1, -1/2, 1/6, 0, -1/30, 0, 1/42, 0, -1/30, 0] """ sig_on() return new_gen(bernfrac(self)) @@ -2802,12 +3000,13 @@ cdef class Gen(Gen_auto): but `B_x` is returned as a real number (with the current precision). - EXAMPLES:: + Examples: - sage: pari(18).bernreal() - 54.9711779448622 - sage: pari(18).bernreal(precision=192).sage() - 54.9711779448621553884711779448621553884711779448621553885 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(18).bernreal() + 54.9711779448622 """ sig_on() return new_gen(bernreal(self, prec_bits_to_words(precision))) @@ -2831,20 +3030,19 @@ cdef class Gen(Gen_auto): - ``x`` - real number (positive or negative) - EXAMPLES:: - - sage: pari(complex(2, 1)).besselk(3) - 0.0455907718407551 + 0.0289192946582081*I + Examples: - :: + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(complex(2, 1)).besselk(-3) - -4.34870874986752 - 5.38744882697109*I + >>> pari(complex(2, 1)).besselk(3) + 0.0455907718407551 + 0.0289192946582081*I - :: + >>> pari(complex(2, 1)).besselk(-3) + -4.34870874986752 - 5.38744882697109*I - sage: pari(complex(2, 1)).besselk(300) - 3.74224603319728 E-132 + 2.49071062641525 E-134*I + >>> pari(complex(2, 1)).besselk(300) + 3.74224603319728 E-132 + 2.49071062641525 E-134*I """ cdef Gen t0 = objtogen(x) sig_on() @@ -2872,7 +3070,7 @@ cdef class Gen(Gen_auto): - See page 262, Prop 5.6.12, of Cohen's book "A Course in Computational Algebraic Number Theory". - EXAMPLES: + Examples: """ sig_on() if n <= 0: @@ -2896,16 +3094,19 @@ cdef class Gen(Gen_auto): TODO: Add more explanation, copied from the PARI manual. - EXAMPLES:: + Examples: - sage: pari(10).polylog(3) - 5.64181141475134 - 8.32820207698027*I - sage: pari(10).polylog(3,0) - 5.64181141475134 - 8.32820207698027*I - sage: pari(10).polylog(3,1) - 0.523778453502411 - sage: pari(10).polylog(3,2) - -0.400459056163451 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(10).polylog(3) + 5.64181141475134 - 8.32820207698027*I + >>> pari(10).polylog(3,0) + 5.64181141475134 - 8.32820207698027*I + >>> pari(10).polylog(3,1) + 0.523778453502411 + >>> pari(10).polylog(3,2) + -0.400459056163451 """ sig_on() return new_gen(polylog0(m, x.g, flag, prec_bits_to_words(precision))) @@ -2947,20 +3148,27 @@ cdef class Gen(Gen_auto): roots - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> s, z = pari(2).sqrtn(5) + >>> z + 0.309016994374947 + 0.951056516295154*I + >>> s + 1.14869835499704 + >>> s**5 + 2.00000000000000 + >>> (s*z)**5 + 2.00000000000000 + 0.E-19*I + - sage: s, z = pari(2).sqrtn(5) - sage: z - 0.309016994374947 + 0.951056516295154*I - sage: s - 1.14869835499704 - sage: s**5 - 2.00000000000000 - sage: z**5 - 1.00000000000000 - 2.710505431 E-20*I # 32-bit - 1.00000000000000 - 2.71050543121376 E-20*I # 64-bit - sage: (s*z)**5 - 2.00000000000000 + 0.E-19*I + >>> import sys + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> s = str(z**5) + >>> s == ('1.00000000000000 - 2.710505431 E-20*I' if bitness == '32' else '1.00000000000000 - 2.71050543121376 E-20*I') + True """ cdef GEN zetan cdef Gen t0 = objtogen(n) @@ -2982,13 +3190,14 @@ cdef class Gen(Gen_auto): - A generator of the multiplicative group of the finite field generated by ``self``. - EXAMPLES:: + Examples: - sage: b = pari(9).ffgen().ffprimroot() - sage: b # random - a + 1 - sage: b.fforder() - 8 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> b = pari(9).ffgen().ffprimroot() + >>> b.fforder() + 8 """ sig_on() return new_gen(ffprimroot(self.g, NULL)) @@ -2997,12 +3206,15 @@ cdef class Gen(Gen_auto): r""" Return the Fibonacci number of index x. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(18).fibonacci() - 2584 - sage: [pari(n).fibonacci() for n in range(10)] - [0, 1, 1, 2, 3, 5, 8, 13, 21, 34] + >>> pari(18).fibonacci() + 2584 + >>> [pari(n).fibonacci() for n in range(10)] + [0, 1, 1, 2, 3, 5, 8, 13, 21, 34] """ sig_on() return new_gen(fibo(self)) @@ -3030,12 +3242,15 @@ cdef class Gen(Gen_auto): def issquarefree(self): """ - EXAMPLES:: + Examples: - sage: pari(10).issquarefree() - True - sage: pari(20).issquarefree() - False + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(10).issquarefree() + True + >>> pari(20).issquarefree() + False """ sig_on() cdef long t = issquarefree(self.g) @@ -3046,10 +3261,13 @@ cdef class Gen(Gen_auto): """ Return the sum of the divisors of `n`. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(10).sumdiv() - 18 + >>> pari(10).sumdiv() + 18 """ sig_on() return new_gen(sumdiv(n.g)) @@ -3058,10 +3276,13 @@ cdef class Gen(Gen_auto): """ Return the sum of the k-th powers of the divisors of n. - EXAMPLES:: + Examples: - sage: pari(10).sumdivk(2) - 130 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(10).sumdivk(2) + 130 """ sig_on() return new_gen(sumdivk(n.g, k)) @@ -3077,12 +3298,15 @@ cdef class Gen(Gen_auto): - ``n`` -- integer or factorisation matrix - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(3).Zn_issquare(4) - False - sage: pari(4).Zn_issquare(pari(30).factor()) - True + >>> pari(3).Zn_issquare(4) + False + >>> pari(4).Zn_issquare(pari(30).factor()) + True """ cdef Gen t0 = objtogen(n) @@ -3102,14 +3326,17 @@ cdef class Gen(Gen_auto): - ``n`` -- integer or factorisation matrix - EXAMPLES:: + Examples: - sage: pari(3).Zn_sqrt(4) - Traceback (most recent call last): - ... - ValueError: 3 is not a square modulo 4 - sage: pari(4).Zn_sqrt(pari(30).factor()) - 22 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(3).Zn_sqrt(4) + Traceback (most recent call last): + ... + ValueError: 3 is not a square modulo 4 + >>> pari(4).Zn_sqrt(pari(30).factor()) + 22 """ cdef Gen t0 = objtogen(n) @@ -3135,21 +3362,24 @@ cdef class Gen(Gen_auto): return a list of Python ints instead of a PARI Gen wrapper. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: e = pari([0, -1, 1, -10, -20]).ellinit() - sage: e.ellan(3) - [1, -2, -1] - sage: e.ellan(20) - [1, -2, -1, 2, 1, 2, -2, 0, -2, -2, 1, -2, 4, 4, -1, -4, -2, 4, 0, 2] - sage: e.ellan(-1) - [] - sage: v = e.ellan(10, python_ints=True); v - [1, -2, -1, 2, 1, 2, -2, 0, -2, -2] - sage: type(v) - <... 'list'> - sage: type(v[0]) - <... 'int'> + >>> e = pari([0, -1, 1, -10, -20]).ellinit() + >>> e.ellan(3) + [1, -2, -1] + >>> e.ellan(20) + [1, -2, -1, 2, 1, 2, -2, 0, -2, -2, 1, -2, 4, 4, -1, -4, -2, 4, 0, 2] + >>> e.ellan(-1) + [] + >>> v = e.ellan(10, python_ints=True); v + [1, -2, -1, 2, 1, 2, -2, 0, -2, -2] + >>> type(v) + <... 'list'> + >>> type(v[0]) + <... 'int'> """ sig_on() cdef GEN g = anell(self.g, n) @@ -3184,32 +3414,35 @@ cdef class Gen(Gen_auto): If this is not the case, use the function ellminimalmodel first before using ellaplist (or you will get INCORRECT RESULTS!) - EXAMPLES:: - - sage: e = pari([0, -1, 1, -10, -20]).ellinit() - sage: v = e.ellaplist(10); v - [-2, -1, 1, -2] - sage: type(v) - - sage: v.type() - 't_VEC' - sage: e.ellan(10) - [1, -2, -1, 2, 1, 2, -2, 0, -2, -2] - sage: v = e.ellaplist(10, python_ints=True); v - [-2, -1, 1, -2] - sage: type(v) - <... 'list'> - sage: type(v[0]) - <... 'int'> - - TESTS:: - - sage: v = e.ellaplist(1) - sage: v, type(v) - ([], ) - sage: v = e.ellaplist(1, python_ints=True) - sage: v, type(v) - ([], <... 'list'>) + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> e = pari([0, -1, 1, -10, -20]).ellinit() + >>> v = e.ellaplist(10); v + [-2, -1, 1, -2] + >>> type(v) + + >>> v.type() + 't_VEC' + >>> e.ellan(10) + [1, -2, -1, 2, 1, 2, -2, 0, -2, -2] + >>> v = e.ellaplist(10, python_ints=True); v + [-2, -1, 1, -2] + >>> type(v) + <... 'list'> + >>> type(v[0]) + <... 'int'> + + Tests: + + >>> v = e.ellaplist(1) + >>> v, type(v) + ([], ) + >>> v = e.ellaplist(1, python_ints=True) + >>> v, type(v) + ([], <... 'list'>) """ if python_ints: return [int(x) for x in self.ellaplist(n)] @@ -3238,19 +3471,22 @@ cdef class Gen(Gen_auto): If the point or the curve have inexact coefficients, an attempt is made to take this into account. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: e = pari([0,1,1,-2,0]).ellinit() - sage: e.ellisoncurve([1,0]) - True - sage: e.ellisoncurve([1,1]) - False - sage: e.ellisoncurve([1,0.00000000000000001]) - False - sage: e.ellisoncurve([1,0.000000000000000001]) - True - sage: e.ellisoncurve([0]) - True + >>> e = pari([0,1,1,-2,0]).ellinit() + >>> e.ellisoncurve([1,0]) + True + >>> e.ellisoncurve([1,1]) + False + >>> e.ellisoncurve([1,0.00000000000000001]) + False + >>> e.ellisoncurve([1,0.000000000000000001]) + True + >>> e.ellisoncurve([0]) + True """ cdef Gen t0 = objtogen(x) sig_on() @@ -3276,16 +3512,19 @@ cdef class Gen(Gen_auto): - ``gen`` - change of coordinates - EXAMPLES:: + Examples: - sage: e = pari([1,2,3,4,5]).ellinit() - sage: F, ch = e.ellminimalmodel() - sage: F[:5] - [1, -1, 0, 4, 3] - sage: ch - [1, -1, 0, -1] - sage: e.ellchangecurve(ch)[:5] - [1, -1, 0, 4, 3] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> e = pari([1,2,3,4,5]).ellinit() + >>> F, ch = e.ellminimalmodel() + >>> F[:5] + [1, -1, 0, 4, 3] + >>> ch + [1, -1, 0, -1] + >>> e.ellchangecurve(ch)[:5] + [1, -1, 0, 4, 3] """ cdef GEN x, y cdef Gen model, change @@ -3319,11 +3558,14 @@ cdef class Gen(Gen_auto): cyclic groups - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: e = pari([1,0,1,-19,26]).ellinit() - sage: e.elltors() - [12, [6, 2], [[1, 2], [3, -2]]] + >>> e = pari([1,0,1,-19,26]).ellinit() + >>> e.elltors() + [12, [6, 2], [[1, 2], [3, -2]]] """ sig_on() return new_gen(elltors(self.g)) @@ -3332,11 +3574,14 @@ cdef class Gen(Gen_auto): """ Return the basis for the period lattice of this elliptic curve. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: e = pari([0, -1, 1, -10, -20]).ellinit() - sage: e.omega() - [1.26920930427955, 0.634604652139777 - 1.45881661693850*I] + >>> e = pari([0, -1, 1, -10, -20]).ellinit() + >>> e.omega() + [1.26920930427955, 0.634604652139777 - 1.45881661693850*I] """ sig_on() return new_gen(ellR_omega(self.g, prec_bits_to_words(precision))) @@ -3345,13 +3590,16 @@ cdef class Gen(Gen_auto): """ Return the discriminant of this object. - EXAMPLES:: + Examples: - sage: e = pari([0, -1, 1, -10, -20]).ellinit() - sage: e.disc() - -161051 - sage: _.factor() - [-1, 1; 11, 5] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> e = pari([0, -1, 1, -10, -20]).ellinit() + >>> e.disc() + -161051 + >>> _.factor() + [-1, 1; 11, 5] """ sig_on() return new_gen(member_disc(self.g)) @@ -3360,13 +3608,16 @@ cdef class Gen(Gen_auto): """ Return the j-invariant of this object. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: e = pari([0, -1, 1, -10, -20]).ellinit() - sage: e.j() - -122023936/161051 - sage: _.factor() - [-1, 1; 2, 12; 11, -5; 31, 3] + >>> e = pari([0, -1, 1, -10, -20]).ellinit() + >>> e.j() + -122023936/161051 + >>> _.factor() + [-1, 1; 2, 12; 11, -5; 31, 3] """ sig_on() return new_gen(member_j(self.g)) @@ -3384,17 +3635,19 @@ cdef class Gen(Gen_auto): PARI ``rnf`` structure. This method may raise errors or return undefined results if called with invalid arguments. - TESTS:: + Tests: - sage: K = pari('y^2 + 1').nfinit() - sage: rnfeq = K._nf_rnfeq('x^2 + 2') - sage: f_abs = rnfeq[0]; f_abs - x^4 + 6*x^2 + 1 - sage: x_rel = rnfeq._eltabstorel('x'); x_rel - Mod(x + Mod(-y, y^2 + 1), x^2 + 2) - sage: f_abs(x_rel) - Mod(0, x^2 + 2) + >>> from cypari2 import Pari + >>> pari = Pari() + >>> K = pari('y^2 + 1').nfinit() + >>> rnfeq = K._nf_rnfeq('x^2 + 2') + >>> f_abs = rnfeq[0]; f_abs + x^4 + 6*x^2 + 1 + >>> x_rel = rnfeq._eltabstorel('x'); x_rel + Mod(x + Mod(-y, y^2 + 1), x^2 + 2) + >>> f_abs(x_rel) + Mod(0, x^2 + 2) """ cdef Gen t0 = objtogen(x) sig_on() @@ -3413,13 +3666,15 @@ cdef class Gen(Gen_auto): PARI ``rnf`` structure. This method may raise errors or return undefined results if called with invalid arguments. - TESTS:: + Tests: - sage: K = pari('y^2 + 1').nfinit() - sage: rnfeq = K._nf_rnfeq('x^2 + 2') - sage: rnfeq._eltabstorel_lift('x') - x + Mod(-y, y^2 + 1) + >>> from cypari2 import Pari + >>> pari = Pari() + >>> K = pari('y^2 + 1').nfinit() + >>> rnfeq = K._nf_rnfeq('x^2 + 2') + >>> rnfeq._eltabstorel_lift('x') + x + Mod(-y, y^2 + 1) """ cdef Gen t0 = objtogen(x) sig_on() @@ -3438,15 +3693,17 @@ cdef class Gen(Gen_auto): PARI ``rnf`` structure. This method may raise errors or return undefined results if called with invalid arguments. - TESTS:: + Tests: - sage: K = pari('y^2 + 1').nfinit() - sage: rnfeq = K._nf_rnfeq('x^2 + 2') - sage: rnfeq._eltreltoabs('x') - 1/2*x^3 + 7/2*x - sage: rnfeq._eltreltoabs('y') - 1/2*x^3 + 5/2*x + >>> from cypari2 import Pari + >>> pari = Pari() + >>> K = pari('y^2 + 1').nfinit() + >>> rnfeq = K._nf_rnfeq('x^2 + 2') + >>> rnfeq._eltreltoabs('x') + 1/2*x^3 + 7/2*x + >>> rnfeq._eltreltoabs('y') + 1/2*x^3 + 5/2*x """ cdef Gen t0 = objtogen(x) sig_on() @@ -3475,14 +3732,17 @@ cdef class Gen(Gen_auto): A vector of all subfields of this group. Each entry is as described in the :meth:`galoisfixedfield` method. - EXAMPLES:: + Examples: - sage: G = pari('x^6 + 108').galoisinit() - sage: G.galoissubfields(flag=1) - [x, x^2 + 972, x^3 + 54, x^3 + 864, x^3 - 54, x^6 + 108] - sage: G = pari('x^4 + 1').galoisinit() - sage: G.galoissubfields(flag=2, v='z')[3] - [x^2 + 2, Mod(x^3 + x, x^4 + 1), [x^2 - z*x - 1, x^2 + z*x - 1]] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> G = pari('x^6 + 108').galoisinit() + >>> G.galoissubfields(flag=1) + [x, x^2 + 972, x^3 + 54, x^3 + 864, x^3 - 54, x^6 + 108] + >>> G = pari('x^4 + 1').galoisinit() + >>> G.galoissubfields(flag=2, v='z')[3] + [x^2 + 2, Mod(x^3 + x, x^4 + 1), [x^2 - z*x - 1, x^2 + z*x - 1]] .. _galoissubfields: http://pari.math.u-bordeaux.fr/dochtml/html.stable/Functions_related_to_general_number_fields.html#galoissubfields """ @@ -3493,12 +3753,15 @@ cdef class Gen(Gen_auto): """ Return the valuation of the number field element `x` at the prime `p`. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: nf = pari('x^2 + 1').nfinit() - sage: p = nf.idealprimedec(5)[0] - sage: nf.nfeltval('50 - 25*x', p) - 3 + >>> nf = pari('x^2 + 1').nfinit() + >>> p = nf.idealprimedec(5)[0] + >>> nf.nfeltval('50 - 25*x', p) + 3 """ cdef Gen t0 = objtogen(x) cdef Gen t1 = objtogen(p) @@ -3534,27 +3797,30 @@ cdef class Gen(Gen_auto): In earlier versions of Sage, other bits in ``flag`` were defined but these are now simply ignored. - EXAMPLES:: + Examples: - sage: pari('x^3 - 17').nfbasis() - [1, x, 1/3*x^2 - 1/3*x + 1/3] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('x^3 - 17').nfbasis() + [1, x, 1/3*x^2 - 1/3*x + 1/3] We test ``flag`` = 1, noting it gives a wrong result when the discriminant (-4 * `p`^2 * `q` in the example below) has a big square - factor:: - - sage: p = pari(10**10).nextprime(); q = (p+1).nextprime() - sage: x = pari('x'); f = x**2 + p**2*q - sage: pari(f).nfbasis(1) # Wrong result - [1, x] - sage: pari(f).nfbasis() # Correct result - [1, 1/10000000019*x] - sage: pari(f).nfbasis(fa=10**6) # Check primes up to 10^6: wrong result - [1, x] - sage: pari(f).nfbasis(fa="[2,2; %s,2]"%p) # Correct result and faster - [1, 1/10000000019*x] - sage: pari(f).nfbasis(fa=[2,p]) # Equivalent with the above - [1, 1/10000000019*x] + factor: + + >>> p = pari(10**10).nextprime(); q = (p+1).nextprime() + >>> x = pari('x'); f = x**2 + p**2*q + >>> pari(f).nfbasis(1) # Wrong result + [1, x] + >>> pari(f).nfbasis() # Correct result + [1, 1/10000000019*x] + >>> pari(f).nfbasis(fa=10**6) # Check primes up to 10^6: wrong result + [1, x] + >>> pari(f).nfbasis(fa="[2,2; %s,2]"%p) # Correct result and faster + [1, 1/10000000019*x] + >>> pari(f).nfbasis(fa=[2,p]) # Equivalent with the above + [1, 1/10000000019*x] """ cdef Gen t0 cdef GEN g0 @@ -3573,22 +3839,21 @@ cdef class Gen(Gen_auto): Like :meth:`nfbasis`, but return a tuple ``(B, D)`` where `B` is the integral basis and `D` the discriminant. - EXAMPLES:: - - sage: F = pari('x^3 - 2').nfinit() - sage: F[0].nfbasis_d() - ([1, x, x^2], -108) + Examples: - :: + >>> from cypari2 import Pari + >>> pari = Pari() - sage: G = pari('x^5 - 11').nfinit() - sage: G[0].nfbasis_d() - ([1, x, x^2, x^3, x^4], 45753125) + >>> F = pari('x^3 - 2').nfinit() + >>> F[0].nfbasis_d() + ([1, x, x^2], -108) - :: + >>> G = pari('x^5 - 11').nfinit() + >>> G[0].nfbasis_d() + ([1, x, x^2, x^3, x^4], 45753125) - sage: pari([-2,0,0,1]).Polrev().nfbasis_d() - ([1, x, x^2], -108) + >>> pari([-2,0,0,1]).Polrev().nfbasis_d() + ([1, x, x^2], -108) """ cdef Gen t0 cdef GEN g0 @@ -3620,17 +3885,20 @@ cdef class Gen(Gen_auto): - ``nf.nfbasistoalg(x).lift()`` - EXAMPLES:: + Examples: - sage: K = pari('x^3 - 17').nfinit() - sage: K.nf_get_zk() - [1, 1/3*x^2 - 1/3*x + 1/3, x] - sage: K.nfbasistoalg_lift(42) - 42 - sage: K.nfbasistoalg_lift("[3/2, -5, 0]~") - -5/3*x^2 + 5/3*x - 1/6 - sage: K.nf_get_zk() * pari("[3/2, -5, 0]~") - -5/3*x^2 + 5/3*x - 1/6 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> K = pari('x^3 - 17').nfinit() + >>> K.nf_get_zk() + [1, 1/3*x^2 - 1/3*x + 1/3, x] + >>> K.nfbasistoalg_lift(42) + 42 + >>> K.nfbasistoalg_lift("[3/2, -5, 0]~") + -5/3*x^2 + 5/3*x - 1/6 + >>> K.nf_get_zk() * pari("[3/2, -5, 0]~") + -5/3*x^2 + 5/3*x - 1/6 """ cdef Gen t0 = objtogen(x) sig_on() @@ -3652,12 +3920,14 @@ cdef class Gen(Gen_auto): :meth:`_eltabstorel`, :meth:`_eltabstorel_lift` and :meth:`_eltreltoabs`. - TESTS:: + Tests: - sage: K = pari('y^2 + 1').nfinit() - sage: K._nf_rnfeq('x^2 + 2') - [x^4 + 6*x^2 + 1, 1/2*x^3 + 5/2*x, -1, y^2 + 1, x^2 + 2] + >>> from cypari2 import Pari + >>> pari = Pari() + >>> K = pari('y^2 + 1').nfinit() + >>> K._nf_rnfeq('x^2 + 2') + [x^4 + 6*x^2 + 1, 1/2*x^3 + 5/2*x, -1, y^2 + 1, x^2 + 2] """ cdef Gen t0 = objtogen(relpol) sig_on() @@ -3678,12 +3948,14 @@ cdef class Gen(Gen_auto): The output of this method is suitable for the method :meth:`_nfeltup`. - TESTS:: + Tests: - sage: nf = pari('y^2 - 2').nfinit() - sage: nf._nf_nfzk(nf._nf_rnfeq('x^2 - 3')) - ([2, -x^3 + 9*x], 1/2) + >>> from cypari2 import Pari + >>> pari = Pari() + >>> nf = pari('y^2 - 2').nfinit() + >>> nf._nf_nfzk(nf._nf_rnfeq('x^2 - 3')) + ([2, -x^3 + 9*x], 1/2) """ cdef GEN zknf, czknf cdef Gen t0 = objtogen(rnfeq) @@ -3713,13 +3985,15 @@ cdef class Gen(Gen_auto): ``rnf`` structure. This method may raise errors or return undefined results if called with invalid arguments. - TESTS:: + Tests: - sage: nf = pari('nfinit(y^2 - 2)') - sage: zk, czk = nf._nf_nfzk(nf._nf_rnfeq('x^2 - 3')) - sage: nf._nfeltup('y', zk, czk) - -1/2*x^3 + 9/2*x + >>> from cypari2 import Pari + >>> pari = Pari() + >>> nf = pari('nfinit(y^2 - 2)') + >>> zk, czk = nf._nf_nfzk(nf._nf_rnfeq('x^2 - 3')) + >>> nf._nfeltup('y', zk, czk) + -1/2*x^3 + 9/2*x """ cdef Gen t0 = objtogen(x) cdef Gen t1 = objtogen(zk) @@ -3744,126 +4018,129 @@ cdef class Gen(Gen_auto): In no case is mixing unnamed and keyword arguments allowed. - EXAMPLES:: + Examples: - sage: f = pari('x^2 + 1') - sage: f.type() - 't_POL' - sage: f.eval(pari('I')) - 0 - sage: f.eval(x=2) - 5 - sage: (1/f).eval(x=1) - 1/2 + >>> from cypari2 import Pari + >>> pari = Pari() - The notation ``f(x)`` is an alternative for ``f.eval(x)``:: + >>> f = pari('x^2 + 1') + >>> f.type() + 't_POL' + >>> f.eval(pari('I')) + 0 + >>> f.eval(x=2) + 5 + >>> (1/f).eval(x=1) + 1/2 + + The notation ``f(x)`` is an alternative for ``f.eval(x)``: - sage: f(3) == f.eval(3) - True + >>> f(3) == f.eval(3) + True - Evaluating power series:: + Evaluating power series: - sage: f = pari('1 + x + x^3 + O(x^7)') - sage: f(2*pari('y')**2) - 1 + 2*y^2 + 8*y^6 + O(y^14) + >>> f = pari('1 + x + x^3 + O(x^7)') + >>> f(2*pari('y')**2) + 1 + 2*y^2 + 8*y^6 + O(y^14) Substituting zero is sometimes possible, and trying to do so - in illegal cases can raise various errors:: - - sage: pari('1 + O(x^3)').eval(0) - 1 - sage: pari('1/x').eval(0) - Traceback (most recent call last): - ... - PariError: impossible inverse in gdiv: 0 - sage: pari('1/x + O(x^2)').eval(0) - Traceback (most recent call last): - ... - PariError: impossible inverse in gsubst: 0 - sage: pari('1/x + O(x^2)').eval(pari('O(x^3)')) - Traceback (most recent call last): - ... - PariError: impossible inverse in gdiv: O(x^3) - sage: pari('O(x^0)').eval(0) - Traceback (most recent call last): - ... - PariError: forbidden substitution t_SER , t_INT - - Evaluating multivariate polynomials:: - - sage: f = pari('y^2 + x^3') - sage: f(1) # Dangerous, depends on PARI variable ordering - y^2 + 1 - sage: f(x=1) # Safe - y^2 + 1 - sage: f(y=1) - x^3 + 1 - sage: f(1, 2) - Traceback (most recent call last): - ... - TypeError: evaluating PARI t_POL takes exactly 1 argument (2 given) - sage: f(y='x', x='2*y') - x^2 + 8*y^3 - sage: f() - x^3 + y^2 - - It's not an error to substitute variables which do not appear:: - - sage: f.eval(z=37) - x^3 + y^2 - sage: pari(42).eval(t=0) - 42 - - We can define and evaluate closures as follows:: - - sage: T = pari('n -> n + 2') - sage: T.type() - 't_CLOSURE' - sage: T.eval(3) - 5 - - sage: T = pari('() -> 42') - sage: T() - 42 - - sage: pr = pari('s -> print(s)') - sage: pr.eval('"hello world"') - hello world - - sage: f = pari('myfunc(x,y) = x*y') - sage: f.eval(5, 6) - 30 + in illegal cases can raise various errors: + + >>> pari('1 + O(x^3)').eval(0) + 1 + >>> pari('1/x').eval(0) + Traceback (most recent call last): + ... + PariError: impossible inverse in gdiv: 0 + >>> pari('1/x + O(x^2)').eval(0) + Traceback (most recent call last): + ... + PariError: impossible inverse in gsubst: 0 + >>> pari('1/x + O(x^2)').eval(pari('O(x^3)')) + Traceback (most recent call last): + ... + PariError: impossible inverse in gdiv: O(x^3) + >>> pari('O(x^0)').eval(0) + Traceback (most recent call last): + ... + PariError: forbidden substitution t_SER , t_INT + + Evaluating multivariate polynomials: + + >>> f = pari('y^2 + x^3') + >>> f(1) # Dangerous, depends on PARI variable ordering + y^2 + 1 + >>> f(x=1) # Safe + y^2 + 1 + >>> f(y=1) + x^3 + 1 + >>> f(1, 2) + Traceback (most recent call last): + ... + TypeError: evaluating PARI t_POL takes exactly 1 argument (2 given) + >>> f(y='x', x='2*y') + x^2 + 8*y^3 + >>> f() + x^3 + y^2 + + It's not an error to substitute variables which do not appear: + + >>> f.eval(z=37) + x^3 + y^2 + >>> pari(42).eval(t=0) + 42 + + We can define and evaluate closures as follows: + + >>> T = pari('n -> n + 2') + >>> T.type() + 't_CLOSURE' + >>> T.eval(3) + 5 + + >>> T = pari('() -> 42') + >>> T() + 42 + + >>> pr = pari('s -> print(s)') + >>> pr.eval('"hello world"') + hello world + + >>> f = pari('myfunc(x,y) = x*y') + >>> f.eval(5, 6) + 30 Default arguments work, missing arguments are treated as zero - (like in GP):: - - sage: f = pari("(x, y, z=1.0) -> [x, y, z]") - sage: f(1, 2, 3) - [1, 2, 3] - sage: f(1, 2) - [1, 2, 1.00000000000000] - sage: f(1) - [1, 0, 1.00000000000000] - sage: f() - [0, 0, 1.00000000000000] - - Variadic closures are supported as well (:trac:`18623`):: - - sage: f = pari("(v[..])->length(v)") - sage: f('a', f) - 2 - sage: g = pari("(x,y,z[..])->[x,y,z]") - sage: g(), g(1), g(1,2), g(1,2,3), g(1,2,3,4) - ([0, 0, []], [1, 0, []], [1, 2, []], [1, 2, [3]], [1, 2, [3, 4]]) + (like in GP): + + >>> f = pari("(x, y, z=1.0) -> [x, y, z]") + >>> f(1, 2, 3) + [1, 2, 3] + >>> f(1, 2) + [1, 2, 1.00000000000000] + >>> f(1) + [1, 0, 1.00000000000000] + >>> f() + [0, 0, 1.00000000000000] + + Variadic closures are supported as well (:trac:`18623`): + + >>> f = pari("(v[..])->length(v)") + >>> f('a', f) + 2 + >>> g = pari("(x,y,z[..])->[x,y,z]") + >>> g(), g(1), g(1,2), g(1,2,3), g(1,2,3,4) + ([0, 0, []], [1, 0, []], [1, 2, []], [1, 2, [3]], [1, 2, [3, 4]]) Using keyword arguments, we can substitute in more complicated - objects, for example a number field:: + objects, for example a number field: - sage: nf = pari('x^2 + 1').nfinit() - sage: nf - [x^2 + 1, [0, 1], -4, 1, [Mat([1, 0.E-38 + 1.00000000000000*I]), [1, 1.00000000000000; 1, -1.00000000000000], [1, 1; 1, -1], [2, 0; 0, -2], [2, 0; 0, 2], [1, 0; 0, -1], [1, [0, -1; 1, 0]], [2]], [0.E-38 + 1.00000000000000*I], [1, x], [1, 0; 0, 1], [1, 0, 0, -1; 0, 1, 1, 0]] - sage: nf(x='y') - [y^2 + 1, [0, 1], -4, 1, [Mat([1, 0.E-38 + 1.00000000000000*I]), [1, 1.00000000000000; 1, -1.00000000000000], [1, 1; 1, -1], [2, 0; 0, -2], [2, 0; 0, 2], [1, 0; 0, -1], [1, [0, -1; 1, 0]], [2]], [0.E-38 + 1.00000000000000*I], [1, y], [1, 0; 0, 1], [1, 0, 0, -1; 0, 1, 1, 0]] + >>> nf = pari('x^2 + 1').nfinit() + >>> nf + [x^2 + 1, [0, 1], -4, 1, [Mat([1, 0.E-38 + 1.00000000000000*I]), [1, 1.00000000000000; 1, -1.00000000000000], [1, 1; 1, -1], [2, 0; 0, -2], [2, 0; 0, 2], [1, 0; 0, -1], [1, [0, -1; 1, 0]], [2]], [0.E-38 + 1.00000000000000*I], [1, x], [1, 0; 0, 1], [1, 0, 0, -1; 0, 1, 1, 0]] + >>> nf(x='y') + [y^2 + 1, [0, 1], -4, 1, [Mat([1, 0.E-38 + 1.00000000000000*I]), [1, 1.00000000000000; 1, -1.00000000000000], [1, 1; 1, -1], [2, 0; 0, -2], [2, 0; 0, 2], [1, 0; 0, -1], [1, [0, -1; 1, 0]], [2]], [0.E-38 + 1.00000000000000*I], [1, y], [1, 0; 0, 1], [1, 0, 0, -1; 0, 1, 1, 0]] """ cdef long t = typ(self.g) cdef Gen t0 @@ -3922,39 +4199,42 @@ cdef class Gen(Gen_auto): This has the same effect as :meth:`eval`. - EXAMPLES:: - - sage: f = pari('Mod(x^2 + x + 1, 3)') - sage: f.type() - 't_POL' - sage: f(2) - Mod(1, 3) - - TESTS:: - - sage: T = pari('n -> 1/n') - sage: T.type() - 't_CLOSURE' - sage: T(0) - Traceback (most recent call last): - ... - PariError: _/_: impossible inverse in gdiv: 0 - sage: pari('() -> 42')(1,2,3) - Traceback (most recent call last): - ... - PariError: too many parameters in user-defined function call - sage: pari('n -> n')(n=2) - Traceback (most recent call last): - ... - TypeError: cannot evaluate a PARI closure using keyword arguments - sage: pari('x + y')(4, y=1) - Traceback (most recent call last): - ... - TypeError: mixing unnamed and keyword arguments not allowed when evaluating a PARI object - sage: pari("12345")(4) - Traceback (most recent call last): - ... - TypeError: cannot evaluate PARI t_INT using unnamed arguments + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> f = pari('Mod(x^2 + x + 1, 3)') + >>> f.type() + 't_POL' + >>> f(2) + Mod(1, 3) + + Tests: + + >>> T = pari('n -> 1/n') + >>> T.type() + 't_CLOSURE' + >>> T(0) + Traceback (most recent call last): + ... + PariError: _/_: impossible inverse in gdiv: 0 + >>> pari('() -> 42')(1,2,3) + Traceback (most recent call last): + ... + PariError: too many parameters in user-defined function call + >>> pari('n -> n')(n=2) + Traceback (most recent call last): + ... + TypeError: cannot evaluate a PARI closure using keyword arguments + >>> pari('x + y')(4, y=1) + Traceback (most recent call last): + ... + TypeError: mixing unnamed and keyword arguments not allowed when evaluating a PARI object + >>> pari("12345")(4) + Traceback (most recent call last): + ... + TypeError: cannot evaluate PARI t_INT using unnamed arguments """ return self.eval(*args, **kwds) @@ -3962,13 +4242,16 @@ cdef class Gen(Gen_auto): """ p-adic factorization of the polynomial ``pol`` to precision ``r``. - EXAMPLES:: + Examples: - sage: pol = pari('x^2 - 1')**2 - sage: pari(pol).factorpadic(5) - [(1 + O(5^20))*x + (1 + O(5^20)), 2; (1 + O(5^20))*x + (4 + 4*5 + 4*5^2 + 4*5^3 + 4*5^4 + 4*5^5 + 4*5^6 + 4*5^7 + 4*5^8 + 4*5^9 + 4*5^10 + 4*5^11 + 4*5^12 + 4*5^13 + 4*5^14 + 4*5^15 + 4*5^16 + 4*5^17 + 4*5^18 + 4*5^19 + O(5^20)), 2] - sage: pari(pol).factorpadic(5,3) - [(1 + O(5^3))*x + (1 + O(5^3)), 2; (1 + O(5^3))*x + (4 + 4*5 + 4*5^2 + O(5^3)), 2] + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pol = pari('x^2 - 1')**2 + >>> pari(pol).factorpadic(5) + [(1 + O(5^20))*x + (1 + O(5^20)), 2; (1 + O(5^20))*x + (4 + 4*5 + 4*5^2 + 4*5^3 + 4*5^4 + 4*5^5 + 4*5^6 + 4*5^7 + 4*5^8 + 4*5^9 + 4*5^10 + 4*5^11 + 4*5^12 + 4*5^13 + 4*5^14 + 4*5^15 + 4*5^16 + 4*5^17 + 4*5^18 + 4*5^19 + O(5^20)), 2] + >>> pari(pol).factorpadic(5,3) + [(1 + O(5^3))*x + (1 + O(5^3)), 2; (1 + O(5^3))*x + (4 + 4*5 + 4*5^2 + O(5^3)), 2] """ cdef Gen t0 = objtogen(p) sig_on() @@ -4010,10 +4293,13 @@ cdef class Gen(Gen_auto): """ Return the number of columns of self. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari('matrix(19,8)').ncols() - 8 + >>> pari('matrix(19,8)').ncols() + 8 """ cdef long n sig_on() @@ -4025,10 +4311,13 @@ cdef class Gen(Gen_auto): """ Return the number of rows of self. - EXAMPLES:: + Examples: - sage: pari('matrix(19,8)').nrows() - 19 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('matrix(19,8)').nrows() + 19 """ cdef long n sig_on() @@ -4045,17 +4334,20 @@ cdef class Gen(Gen_auto): """ Transpose of the matrix self. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari('[1,2,3; 4,5,6; 7,8,9]').mattranspose() - [1, 4, 7; 2, 5, 8; 3, 6, 9] + >>> pari('[1,2,3; 4,5,6; 7,8,9]').mattranspose() + [1, 4, 7; 2, 5, 8; 3, 6, 9] - Unlike PARI, this always returns a matrix:: + Unlike PARI, this always returns a matrix: - sage: pari('[1,2,3]').mattranspose() - [1; 2; 3] - sage: pari('[1,2,3]~').mattranspose() - Mat([1, 2, 3]) + >>> pari('[1,2,3]').mattranspose() + [1; 2; 3] + >>> pari('[1,2,3]~').mattranspose() + Mat([1, 2, 3]) """ sig_on() return new_gen(gtrans(self.g)).Mat() @@ -4074,15 +4366,18 @@ cdef class Gen(Gen_auto): 1 to `2B`, 2: return a ``t_VECSMALL`` instead of a ``t_VEC`` (which is faster). - EXAMPLES:: + Examples: - sage: M = pari("[5,1,1;1,3,1;1,1,1]") - sage: M.qfrep(20) - [1, 1, 2, 2, 2, 4, 4, 3, 3, 4, 2, 4, 6, 0, 4, 6, 4, 5, 6, 4] - sage: M.qfrep(20, flag=1) - [1, 2, 4, 3, 4, 4, 0, 6, 5, 4, 12, 4, 4, 8, 0, 3, 8, 6, 12, 12] - sage: M.qfrep(20, flag=2) - Vecsmall([1, 1, 2, 2, 2, 4, 4, 3, 3, 4, 2, 4, 6, 0, 4, 6, 4, 5, 6, 4]) + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> M = pari("[5,1,1;1,3,1;1,1,1]") + >>> M.qfrep(20) + [1, 1, 2, 2, 2, 4, 4, 3, 3, 4, 2, 4, 6, 0, 4, 6, 4, 5, 6, 4] + >>> M.qfrep(20, flag=1) + [1, 2, 4, 3, 4, 4, 0, 6, 5, 4, 12, 4, 4, 8, 0, 3, 8, 6, 12, 12] + >>> M.qfrep(20, flag=2) + Vecsmall([1, 1, 2, 2, 2, 4, 4, 3, 3, 4, 2, 4, 6, 0, 4, 6, 4, 5, 6, 4]) """ # PARI 2.7 always returns a t_VECSMALL, but for backwards # compatibility, we keep returning a t_VEC (unless flag & 2) @@ -4101,15 +4396,22 @@ cdef class Gen(Gen_auto): This is the LLL-reduced Z-basis of the kernel of the matrix x with integral entries. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari('[2,1;2,1]').matker() - [-1/2; 1] - sage: pari('[2,1;2,1]').matkerint() - [1; -2] - sage: pari('[2,1;2,1]').matkerint(1) - doctest:...: DeprecationWarning: the 'flag' argument of the PARI/GP function matkerint is obsolete - [1; -2] + >>> pari('[2,1;2,1]').matker() + [-1/2; 1] + >>> pari('[2,1;2,1]').matkerint() + [1; -2] + >>> import warnings + >>> with warnings.catch_warnings(record=True) as w: + ... warnings.simplefilter('always') + ... pari('[2,1;2,1]').matkerint(1) + ... assert len(w) == 1 + ... assert issubclass(w[0].category, DeprecationWarning) + [1; -2] """ if flag: # Keep this deprecation warning as long as PARI supports @@ -4135,36 +4437,39 @@ cdef class Gen(Gen_auto): global PARI default ``factor_proven`` which is ``True`` by default in Sage. - EXAMPLES:: + Examples: - sage: pari('x^10-1').factor() - [x - 1, 1; x + 1, 1; x^4 - x^3 + x^2 - x + 1, 1; x^4 + x^3 + x^2 + x + 1, 1] - sage: pari(2**100-1).factor() - [3, 1; 5, 3; 11, 1; 31, 1; 41, 1; 101, 1; 251, 1; 601, 1; 1801, 1; 4051, 1; 8101, 1; 268501, 1] - sage: pari(2**100-1).factor(proof=True) - [3, 1; 5, 3; 11, 1; 31, 1; 41, 1; 101, 1; 251, 1; 601, 1; 1801, 1; 4051, 1; 8101, 1; 268501, 1] - sage: pari(2**100-1).factor(proof=False) - [3, 1; 5, 3; 11, 1; 31, 1; 41, 1; 101, 1; 251, 1; 601, 1; 1801, 1; 4051, 1; 8101, 1; 268501, 1] + >>> from cypari2 import Pari + >>> pari = Pari() - We illustrate setting a limit:: + >>> pari('x^10-1').factor() + [x - 1, 1; x + 1, 1; x^4 - x^3 + x^2 - x + 1, 1; x^4 + x^3 + x^2 + x + 1, 1] + >>> pari(2**100-1).factor() + [3, 1; 5, 3; 11, 1; 31, 1; 41, 1; 101, 1; 251, 1; 601, 1; 1801, 1; 4051, 1; 8101, 1; 268501, 1] + >>> pari(2**100-1).factor(proof=True) + [3, 1; 5, 3; 11, 1; 31, 1; 41, 1; 101, 1; 251, 1; 601, 1; 1801, 1; 4051, 1; 8101, 1; 268501, 1] + >>> pari(2**100-1).factor(proof=False) + [3, 1; 5, 3; 11, 1; 31, 1; 41, 1; 101, 1; 251, 1; 601, 1; 1801, 1; 4051, 1; 8101, 1; 268501, 1] - sage: pari(pari(10**50).nextprime()*pari(10**60).nextprime()*pari(10**4).nextprime()).factor(10**5) - [10007, 1; 100000000000000000000000000000000000000000000000151000000000700000000000000000000000000000000000000000000001057, 1] + We illustrate setting a limit: - Setting a limit is invalid when factoring polynomials:: + >>> pari(pari(10**50).nextprime()*pari(10**60).nextprime()*pari(10**4).nextprime()).factor(10**5) + [10007, 1; 100000000000000000000000000000000000000000000000151000000000700000000000000000000000000000000000000000000001057, 1] - sage: pari('x^11 + 1').factor(limit=17) - Traceback (most recent call last): - ... - PariError: incorrect type in boundfact (t_POL) + Setting a limit is invalid when factoring polynomials: + + >>> pari('x^11 + 1').factor(limit=17) + Traceback (most recent call last): + ... + PariError: incorrect type in boundfact (t_POL) PARI doesn't have an algorithm for factoring multivariate - polynomials:: + polynomials: - sage: pari('x^3 - y^3').factor() - Traceback (most recent call last): - ... - PariError: sorry, factor for general polynomials is not yet implemented + >>> pari('x^3 - y^3').factor() + Traceback (most recent call last): + ... + PariError: sorry, factor for general polynomials is not yet implemented """ cdef GEN g global factor_proven @@ -4194,16 +4499,19 @@ cdef class Gen(Gen_auto): If ``add_one`` is non-zero, return the smallest pseudoprime strictly greater than `x`. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(1).nextprime() - 2 - sage: pari(2).nextprime() - 2 - sage: pari(2).nextprime(add_one = 1) - 3 - sage: pari(2**100).nextprime() - 1267650600228229401496703205653 + >>> pari(1).nextprime() + 2 + >>> pari(2).nextprime() + 2 + >>> pari(2).nextprime(add_one = 1) + 3 + >>> pari(2**100).nextprime() + 1267650600228229401496703205653 """ sig_on() if add_one: @@ -4224,27 +4532,30 @@ cdef class Gen(Gen_auto): use this function on polynomials with integer or rational coefficients. For a safer alternative, use :meth:`subst`. - EXAMPLES:: + Examples: - sage: f = pari('x^3 + 17*x + 3') - sage: f.change_variable_name("y") - y^3 + 17*y + 3 - sage: f = pari('1 + 2*y + O(y^10)') - sage: f.change_variable_name("q") - 1 + 2*q + O(q^10) - sage: f.change_variable_name("y") is f - True + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> f = pari('x^3 + 17*x + 3') + >>> f.change_variable_name("y") + y^3 + 17*y + 3 + >>> f = pari('1 + 2*y + O(y^10)') + >>> f.change_variable_name("q") + 1 + 2*q + O(q^10) + >>> f.change_variable_name("y") is f + True In PARI, ``I`` refers to the square root of -1, so it cannot be - used as variable name. Note the difference with :meth:`subst`:: + used as variable name. Note the difference with :meth:`subst`: - sage: f = pari('x^2 + 1') - sage: f.change_variable_name("I") - Traceback (most recent call last): - ... - PariError: I already exists with incompatible valence - sage: f.subst("x", "I") - 0 + >>> f = pari('x^2 + 1') + >>> f.change_variable_name("I") + Traceback (most recent call last): + ... + PariError: I already exists with incompatible valence + >>> f.subst("x", "I") + 0 """ cdef long n = get_var(var) if varn(self.g) == n: @@ -4266,30 +4577,33 @@ cdef class Gen(Gen_auto): - ``self`` -- A PARI number field being the output of ``nfinit()``, ``bnfinit()`` or ``bnrinit()``. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: K = pari('y^2 + 5').nfinit() + >>> K = pari('y^2 + 5').nfinit() - We can substitute in a PARI ``nf`` structure:: + We can substitute in a PARI ``nf`` structure: - sage: K.nf_get_pol() - y^2 + 5 - sage: L = K.nf_subst('a') - sage: L.nf_get_pol() - a^2 + 5 + >>> K.nf_get_pol() + y^2 + 5 + >>> L = K.nf_subst('a') + >>> L.nf_get_pol() + a^2 + 5 - We can also substitute in a PARI ``bnf`` structure:: + We can also substitute in a PARI ``bnf`` structure: - sage: K = pari('y^2 + 5').bnfinit() - sage: K.nf_get_pol() - y^2 + 5 - sage: K.bnf_get_cyc() # Structure of class group - [2] - sage: L = K.nf_subst('a') - sage: L.nf_get_pol() - a^2 + 5 - sage: L.bnf_get_cyc() # We still have a bnf after substituting - [2] + >>> K = pari('y^2 + 5').bnfinit() + >>> K.nf_get_pol() + y^2 + 5 + >>> K.bnf_get_cyc() # Structure of class group + [2] + >>> L = K.nf_subst('a') + >>> L.nf_get_pol() + a^2 + 5 + >>> L.bnf_get_cyc() # We still have a bnf after substituting + [2] """ cdef Gen t0 = objtogen(z) sig_on() @@ -4304,14 +4618,17 @@ cdef class Gen(Gen_auto): In Cython, it is much faster to simply use typ(self.g) for checking PARI types. - EXAMPLES:: + Examples: - sage: pari(7).type() - 't_INT' - sage: pari('x').type() - 't_POL' - sage: pari('oo').type() - 't_INFINITY' + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari(7).type() + 't_INT' + >>> pari('x').type() + 't_POL' + >>> pari('oo').type() + 't_INFINITY' """ # The following original code leaks memory: # return str(type_name(typ(self.g))) @@ -4395,44 +4712,47 @@ cdef class Gen(Gen_auto): - `P(z)` (if ``flag`` is 0) or `[P(z), P'(z)]` (if ``flag`` is 1). numbers - EXAMPLES: + Examples: + + We first define the elliptic curve X_0(11): - We first define the elliptic curve X_0(11):: + >>> from cypari2 import Pari + >>> pari = Pari() - sage: E = pari([0,-1,1,-10,-20]).ellinit() + >>> E = pari([0,-1,1,-10,-20]).ellinit() - Compute P(1):: + Compute P(1): - sage: E.ellwp(1) - 13.9658695257485 + >>> E.ellwp(1) + 13.9658695257485 - Compute P(1+i), where i = sqrt(-1):: + Compute P(1+i), where i = sqrt(-1): - sage: E.ellwp(pari(complex(1, 1))) - -1.11510682565555 + 2.33419052307470*I - sage: E.ellwp(complex(1, 1)) - -1.11510682565555 + 2.33419052307470*I + >>> E.ellwp(pari(complex(1, 1))) + -1.11510682565555 + 2.33419052307470*I + >>> E.ellwp(complex(1, 1)) + -1.11510682565555 + 2.33419052307470*I - The series expansion, to the default `O(z^20)` precision:: + The series expansion, to the default `O(z^20)` precision: - sage: E.ellwp() - z^-2 + 31/15*z^2 + 2501/756*z^4 + 961/675*z^6 + 77531/41580*z^8 + 1202285717/928746000*z^10 + 2403461/2806650*z^12 + 30211462703/43418875500*z^14 + 3539374016033/7723451736000*z^16 + 413306031683977/1289540602350000*z^18 + O(z^20) + >>> E.ellwp() + z^-2 + 31/15*z^2 + 2501/756*z^4 + 961/675*z^6 + 77531/41580*z^8 + 1202285717/928746000*z^10 + 2403461/2806650*z^12 + 30211462703/43418875500*z^14 + 3539374016033/7723451736000*z^16 + 413306031683977/1289540602350000*z^18 + O(z^20) - Compute the series for wp to lower precision:: + Compute the series for wp to lower precision: - sage: E.ellwp(n=4) - z^-2 + 31/15*z^2 + O(z^4) + >>> E.ellwp(n=4) + z^-2 + 31/15*z^2 + O(z^4) Next we use the version where the input is generators for a - lattice:: + lattice: - sage: pari([1.2692, complex(0.63, 1.45)]).ellwp(1) - 13.9656146936689 + 0.000644829272810...*I + >>> pari([1.2692, complex(0.63, 1.45)]).ellwp(1) + 13.9656146936689 + 0.000644829272810...*I - With flag=1, compute the pair P(z) and P'(z):: + With flag=1, compute the pair P(z) and P'(z): - sage: E.ellwp(1, flag=1) - [13.9658695257485, 50.5619300880073] + >>> E.ellwp(1, flag=1) + [13.9658695257485, 50.5619300880073] """ cdef Gen t0 = objtogen(z) cdef GEN g0 = t0.g @@ -4449,16 +4769,19 @@ cdef class Gen(Gen_auto): r""" Show the internal structure of self (like the ``\x`` command in gp). - EXAMPLES:: + Examples: - sage: pari('[1/2, 1.0*I]').debug() # random addresses - [&=0000000004c5f010] VEC(lg=3):2200000000000003 0000000004c5eff8 0000000004c5efb0 - 1st component = [&=0000000004c5eff8] FRAC(lg=3):0800000000000003 0000000004c5efe0 0000000004c5efc8 - num = [&=0000000004c5efe0] INT(lg=3):0200000000000003 (+,lgefint=3):4000000000000003 0000000000000001 - den = [&=0000000004c5efc8] INT(lg=3):0200000000000003 (+,lgefint=3):4000000000000003 0000000000000002 - 2nd component = [&=0000000004c5efb0] COMPLEX(lg=3):0c00000000000003 00007fae8a2eb840 0000000004c5ef90 - real = gen_0 - imag = [&=0000000004c5ef90] REAL(lg=4):0400000000000004 (+,expo=0):6000000000000000 8000000000000000 0000000000000000 + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> pari('[1/2, 1.0*I]').debug() + [&=...] VEC(lg=3):... + 1st component = [&=...] FRAC(lg=3):... + num = [&=...] INT(lg=3):... (+,lgefint=3):... + den = [&=...] INT(lg=3):... (+,lgefint=3):... + 2nd component = [&=...] COMPLEX(lg=3):... + real = [&=...] INT(lg=2):... (0,lgefint=2):... + imag = [&=...] REAL(lg=3):... (+,expo=0):... """ sig_on() dbgGEN(self.g, depth) @@ -4476,13 +4799,20 @@ cdef class Gen(Gen_auto): to bernfrac, which is faster than the standard recursion in exact arithmetic. - EXAMPLES:: + Examples: + + >>> from cypari2 import Pari + >>> pari = Pari() - sage: pari(8).bernvec() - doctest:...: DeprecationWarning: the PARI/GP function bernvec() is obsolete: use repeated calls to bernfrac() instead - [1, 1/6, -1/30, 1/42, -1/30, 5/66, -691/2730, 7/6, -3617/510] - sage: [pari(2*n).bernfrac() for n in range(9)] - [1, 1/6, -1/30, 1/42, -1/30, 5/66, -691/2730, 7/6, -3617/510] + >>> import warnings + >>> with warnings.catch_warnings(record=True) as w: + ... warnings.simplefilter('always') + ... pari(8).bernvec() + ... assert len(w) == 1 + ... assert issubclass(w[0].category, DeprecationWarning) + [1, 1/6, -1/30, 1/42, -1/30, 5/66, -691/2730, 7/6, -3617/510] + >>> [pari(2*n).bernfrac() for n in range(9)] + [1, 1/6, -1/30, 1/42, -1/30, 5/66, -691/2730, 7/6, -3617/510] """ from warnings import warn warn('the PARI/GP function bernvec() is obsolete: use repeated calls to bernfrac() instead', DeprecationWarning) @@ -4493,12 +4823,14 @@ cdef class Gen(Gen_auto): """ Do not use this. Use ``pari.allocatemem()`` instead. - TESTS:: + Tests: - sage: pari(2**10).allocatemem(2**20) - Traceback (most recent call last): - ... - NotImplementedError: the method allocatemem() should not be used; use pari.allocatemem() instead + >>> from cypari2 import Pari + >>> pari = Pari() + >>> pari(2**10).allocatemem(2**20) + Traceback (most recent call last): + ... + NotImplementedError: the method allocatemem() should not be used; use pari.allocatemem() instead """ raise NotImplementedError("the method allocatemem() should not be used; use pari.allocatemem() instead") @@ -4512,18 +4844,21 @@ cdef Gen list_of_Gens_to_Gen(list s): This is called from :func:`objtogen` to convert iterables to PARI. - TESTS:: - - sage: from six.moves import range - sage: from sage.libs.cypari2.gen import objtogen - sage: objtogen(range(10)) - [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] - sage: objtogen(i**2 for i in range(5)) - [0, 1, 4, 9, 16] - sage: objtogen([pari("Mod(x, x^2+1)")]) - [Mod(x, x^2 + 1)] - sage: objtogen([]) - [] + Tests: + + >>> from six.moves import range + >>> from cypari2.gen import objtogen + >>> from cypari2 import Pari + >>> pari = Pari() + + >>> objtogen(range(10)) + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] + >>> objtogen(i**2 for i in range(5)) + [0, 1, 4, 9, 16] + >>> objtogen([pari("Mod(x, x^2+1)")]) + [Mod(x, x^2 + 1)] + >>> objtogen([]) + [] """ cdef Py_ssize_t length = len(s) @@ -4544,92 +4879,108 @@ cpdef Gen objtogen(s): Basic Python types like ``int`` are converted directly. For other types, the string representation is used. - EXAMPLES:: - - sage: pari(0) - 0 - sage: pari([2,3,5]) - [2, 3, 5] - - :: + Examples: - sage: a = pari(1); a, a.type() - (1, 't_INT') - sage: from fractions import Fraction - sage: a = pari(Fraction('1/2')); a, a.type() - (1/2, 't_FRAC') - - Conversion from reals uses the real's own precision:: - - sage: a = pari(1.2); a, a.type(), a.precision() - (1.20000000000000, 't_REAL', 4) # 32-bit - (1.20000000000000, 't_REAL', 3) # 64-bit - - Conversion from strings uses the current PARI real precision. - By default, this is 64 bits:: + >>> from cypari2 import Pari + >>> pari = Pari() - sage: a = pari('1.2'); a, a.type(), a.precision() - (1.20000000000000, 't_REAL', 4) # 32-bit - (1.20000000000000, 't_REAL', 3) # 64-bit + >>> pari(0) + 0 + >>> pari([2,3,5]) + [2, 3, 5] - Unicode and bytes work fine:: + >>> a = pari(1) + >>> a, a.type() + (1, 't_INT') - sage: pari(b"zeta(3)") - 1.20205690315959 - sage: pari(u"zeta(3)") - 1.20205690315959 + >>> from fractions import Fraction + >>> a = pari(Fraction('1/2')) + >>> a, a.type() + (1/2, 't_FRAC') - But we can change this precision:: + Conversion from reals uses the real's own precision: - sage: pari.set_real_precision(35) # precision in decimal digits - 15 - sage: a = pari('1.2'); a, a.type(), a.precision() - (1.2000000000000000000000000000000000, 't_REAL', 6) # 32-bit - (1.2000000000000000000000000000000000, 't_REAL', 4) # 64-bit + >>> a = pari(1.2); a, a.type() + (1.20000000000000, 't_REAL') + >>> import sys + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> a.precision() == (4 if bitness == '32' else 3) + True - Set the precision to 15 digits for the remaining tests:: - - sage: pari.set_real_precision(15) - 35 - - Conversion from basic Python types:: - - sage: pari(int(-5)) - -5 - sage: pari(long(2**150)) - 1427247692705959881058285969449495136382746624 - sage: pari(float(pi)) - 3.14159265358979 - sage: one = pari(complex(1,0)); one, one.type() - (1.00000000000000, 't_COMPLEX') - sage: pari(complex(0, 1)) - 1.00000000000000*I - sage: pari(complex(exp(pi*I/4))) - 0.707106781186548 + 0.707106781186548*I - sage: pari(False) - 0 - sage: pari(True) - 1 - - Some commands are just executed without returning a value:: - - sage: pari("dummy = 0; kill(dummy)") - sage: type(pari("dummy = 0; kill(dummy)")) - - - TESTS:: - - sage: pari(None) - Traceback (most recent call last): - ... - ValueError: Cannot convert None to pari - - sage: class OldStylePari: - ....: def _pari_(self): - ....: return pari(42) - sage: pari(OldStylePari()) - doctest:...: DeprecationWarning: the _pari_ method is deprecated, use __pari__ instead - 42 + Conversion from strings uses the current PARI real precision. + By default, this is 64 bits: + + >>> a = pari('1.2'); a, a.type() + (1.20000000000000, 't_REAL') + >>> a.precision() == (4 if bitness == '32' else 3) + True + + Unicode and bytes work fine: + + >>> pari(b"zeta(3)") + 1.20205690315959 + >>> pari(u"zeta(3)") + 1.20205690315959 + + But we can change this precision: + + >>> pari.set_real_precision(35) # precision in decimal digits + 15 + >>> a = pari('1.2'); a, a.type() + (1.2000000000000000000000000000000000, 't_REAL') + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> a.precision() == (6 if bitness == '32' else 4) + True + + Set the precision to 15 digits for the remaining tests: + + >>> pari.set_real_precision(15) + 35 + + Conversion from basic Python types: + + >>> pari(int(-5)) + -5 + >>> pari(long(2**150)) + 1427247692705959881058285969449495136382746624 + >>> import math + >>> pari(math.pi) + 3.14159265358979 + >>> one = pari(complex(1,0)); one, one.type() + (1.00000000000000, 't_COMPLEX') + >>> pari(complex(0, 1)) + 1.00000000000000*I + >>> pari(complex(0.3, 1.7)) + 0.300000000000000 + 1.70000000000000*I + + >>> pari(False) + 0 + >>> pari(True) + 1 + + Some commands are just executed without returning a value: + + >>> pari("dummy = 0; kill(dummy)") + >>> type(pari("dummy = 0; kill(dummy)")) + + + Tests: + + >>> pari(None) + Traceback (most recent call last): + ... + ValueError: Cannot convert None to pari + + >>> class OldStylePari: + ... def _pari_(self): + ... return pari(42) + >>> import warnings + >>> with warnings.catch_warnings(record=True) as w: + ... warnings.simplefilter('always') + ... pari(OldStylePari()) + ... assert len(w) == 1 + ... assert issubclass(w[0].category, DeprecationWarning) + 42 """ cdef GEN g cdef list L diff --git a/cypari2/handle_error.pyx b/cypari2/handle_error.pyx index 0abd5da8..4799b151 100644 --- a/cypari2/handle_error.pyx +++ b/cypari2/handle_error.pyx @@ -41,13 +41,15 @@ class PariError(RuntimeError): r""" Return the PARI error number corresponding to this exception. - EXAMPLES:: - - sage: try: - ....: pari('1/0') - ....: except PariError as err: - ....: print(err.errnum()) - 31 + EXAMPLES: + + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> try: + ... pari('1/0') + ... except PariError as err: + ... print(err.errnum()) + 31 """ return self.args[0] @@ -55,14 +57,15 @@ class PariError(RuntimeError): """ Return the message output by PARI when this error occurred. - EXAMPLES:: - - sage: try: - ....: pari('pi()') - ....: except PariError as e: - ....: print(e.errtext()) - not a function in function call + EXAMPLES: + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> try: + ... pari('pi()') + ... except PariError as e: + ... print(e.errtext()) + not a function in function call """ return self.args[1] @@ -71,26 +74,30 @@ class PariError(RuntimeError): Return the error data (a ``t_ERROR`` gen) corresponding to this error. - EXAMPLES:: - - sage: try: - ....: pari('Mod(2,6)')**-1 - ....: except PariError as e: - ....: E = e.errdata() - sage: E - error("impossible inverse in Fp_inv: Mod(2, 6).") - sage: E.component(2) - Mod(2, 6) - """ + EXAMPLES: + + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> try: + ... pari('Mod(2,6)')**-1 + ... except PariError as e: + ... E = e.errdata() + >>> E + error("impossible inverse in Fp_inv: Mod(2, 6).") + >>> E.component(2) + Mod(2, 6) + """ return self.args[2] def __repr__(self): r""" - TESTS:: + TESTS: - sage: PariError(11) - PariError(11) - """ + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> PariError(11) + PariError(11) + """ return "PariError(%d)"%self.errnum() def __str__(self): @@ -100,20 +107,22 @@ class PariError(RuntimeError): This is simply the error text with certain trailing characters stripped. - EXAMPLES:: + EXAMPLES: - sage: try: - ....: pari('1/0') - ....: except PariError as err: - ....: print(err) - _/_: impossible inverse in gdiv: 0 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> try: + ... pari('1/0') + ... except PariError as err: + ... print(err) + _/_: impossible inverse in gdiv: 0 A syntax error:: - sage: pari('!@#$%^&*()') - Traceback (most recent call last): - ... - PariError: syntax error, unexpected $undefined + >>> pari('!@#$%^&*()') + Traceback (most recent call last): + ... + PariError: syntax error, unexpected $undefined """ return self.errtext().rstrip(" .:") @@ -122,18 +131,20 @@ cdef void _pari_init_error_handling(): """ Set up our code for handling PARI errors. - TESTS:: + TESTS: - sage: try: - ....: p = pari.polcyclo(-1) - ....: except PariError as e: - ....: print(e.errtext()) - domain error in polcyclo: index <= 0 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> try: + ... p = pari.polcyclo(-1) + ... except PariError as e: + ... print(e.errtext()) + domain error in polcyclo: index <= 0 Warnings still work just like in GP:: - sage: pari('warning("test")') - *** user warning: test + >>> pari('warning("test")') + *** user warning: test """ global cb_pari_err_handle global cb_pari_err_recover @@ -147,17 +158,18 @@ cdef int _pari_err_handle(GEN E) except 0: This function is a callback from the PARI error handler. - EXAMPLES:: - - sage: pari('error("test")') - Traceback (most recent call last): - ... - PariError: error: user error: test - sage: pari(1)/pari(0) - Traceback (most recent call last): - ... - PariError: impossible inverse in gdiv: 0 - + EXAMPLES: + + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari('error("test")') + Traceback (most recent call last): + ... + PariError: error: user error: test + >>> pari(1)/pari(0) + Traceback (most recent call last): + ... + PariError: impossible inverse in gdiv: 0 """ cdef long errnum = E[1] cdef char* errstr @@ -193,14 +205,15 @@ cdef void _pari_err_recover(long errnum): TEST: Perform a computation that requires doubling the default stack - several times:: - - sage: pari.allocatemem(2**12, 2**26) - PARI stack size set to 4096 bytes, maximum size set to 67108864 - sage: x = pari('2^(2^26)') - sage: x == 2**(2**26) - True - + several times: + + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.allocatemem(2**12, 2**26) + PARI stack size set to 4096 bytes, maximum size set to 67108864 + >>> x = pari('2^(2^26)') + >>> x == 2**(2**26) + True """ # An exception was raised. Jump to the signal-handling code # which will cause sig_on() to see the exception. diff --git a/cypari2/pari_instance.pyx b/cypari2/pari_instance.pyx index 3e9ae517..1c9daded 100644 --- a/cypari2/pari_instance.pyx +++ b/cypari2/pari_instance.pyx @@ -31,26 +31,28 @@ AUTHORS: - Luca De Feo (2016-09-06): Separate Sage-specific components from generic C-interface in ``Pari`` (:trac:`20241`) -EXAMPLES:: - - sage: pari('5! + 10/x') - (120*x + 10)/x - sage: pari('intnum(x=0,13,sin(x)+sin(x^2) + x)') - 85.6215190762676 - sage: f = pari('x^3-1') - sage: v = f.factor(); v - [x - 1, 1; x^2 + x + 1, 1] - sage: v[0] # indexing is 0-based unlike in GP. - [x - 1, x^2 + x + 1]~ - sage: v[1] - [1, 1]~ - -Arithmetic operations cause all arguments to be converted to PARI:: - - sage: type(pari(1) + 1) - - sage: type(1 + pari(1)) - +Examples: + +>>> import cypari2 +>>> pari = cypari2.Pari() +>>> pari('5! + 10/x') +(120*x + 10)/x +>>> pari('intnum(x=0,13,sin(x)+sin(x^2) + x)') +85.6215190762676 +>>> f = pari('x^3-1') +>>> v = f.factor(); v +[x - 1, 1; x^2 + x + 1, 1] +>>> v[0] # indexing is 0-based unlike in GP. +[x - 1, x^2 + x + 1]~ +>>> v[1] +[1, 1]~ + +Arithmetic operations cause all arguments to be converted to PARI: + +>>> type(pari(1) + 1) + +>>> type(1 + pari(1)) + Guide to real precision in the PARI interface ============================================= @@ -66,40 +68,41 @@ Real numbers in PARI have a precision associated to them, which is always a multiple of the CPU wordsize. So, it is a multiple of 32 of 64 bits. When converting a ``float`` from Python to PARI, the ``float`` has 53 bits of precision which is rounded up to 64 bits -in PARI:: +in PARI: - sage: x = 1.0 - sage: pari(x) - 1.00000000000000 - sage: pari(x).bitprecision() - 64 +>>> x = 1.0 +>>> pari(x) +1.00000000000000 +>>> pari(x).bitprecision() +64 It is possible to change the precision of a PARI object with the -:meth:`Gen.bitprecision` method:: +:meth:`Gen.bitprecision` method: - sage: p = pari(1.0) - sage: p.bitprecision() - 64 - sage: p = p.bitprecision(100) - sage: p.bitprecision() # Rounded up to a multiple of the wordsize - 128 +>>> p = pari(1.0) +>>> p.bitprecision() +64 +>>> p = p.bitprecision(100) +>>> p.bitprecision() # Rounded up to a multiple of the wordsize +128 Beware that these extra bits are just bogus. For example, this will not give a more precision approximation of ``math.pi``: - sage: p = pari(math.pi) - sage: pari("Pi") - p - 1.225148... E-16 - sage: p = p.bitprecision(1000) - sage: pari("Pi") - p - 1.225148... E-16 +>>> import math +>>> p = pari(math.pi) +>>> pari("Pi") - p +1.225148... E-16 +>>> p = p.bitprecision(1000) +>>> pari("Pi") - p +1.225148... E-16 Another way to create numbers with many bits is to use a string with -many digits:: +many digits: - sage: p = pari("3.1415926535897932384626433832795028842") - sage: p.bitprecision() - 128 +>>> p = pari("3.1415926535897932384626433832795028842") +>>> p.bitprecision() +128 .. _pari_output_precision: @@ -115,27 +118,27 @@ Note that this will also change the input precision for strings, see :ref:`pari_input_precision`. We create a very precise approximation of pi and see how it is printed -in PARI:: +in PARI: - sage: pi = pari.pi(precision=1024) +>>> pi = pari.pi(precision=1024) -The default precision is 15 digits:: +The default precision is 15 digits: - sage: pi - 3.14159265358979 +>>> pi +3.14159265358979 With a different precision, we see more digits. Note that this does not -affect the object ``pi`` at all, it only affects how it is printed:: +affect the object ``pi`` at all, it only affects how it is printed: - sage: _ = pari.set_real_precision(50) - sage: pi - 3.1415926535897932384626433832795028841971693993751 +>>> _ = pari.set_real_precision(50) +>>> pi +3.1415926535897932384626433832795028841971693993751 -Back to the default:: +Back to the default: - sage: _ = pari.set_real_precision(15) - sage: pi - 3.14159265358979 +>>> _ = pari.set_real_precision(15) +>>> pi +3.14159265358979 .. _pari_input_precision: @@ -155,14 +158,14 @@ three kinds of calls: In the first case, the relevant precision is the one set by the methods :meth:`Pari.set_real_precision_bits` or -:meth:`Pari.set_real_precision`:: +:meth:`Pari.set_real_precision`: - sage: pari.set_real_precision_bits(150) - sage: pari("sin(1)") - 0.841470984807896506652502321630298999622563061 - sage: pari.set_real_precision_bits(53) - sage: pari("sin(1)") - 0.841470984807897 +>>> pari.set_real_precision_bits(150) +>>> pari("sin(1)") +0.841470984807896506652502321630298999622563061 +>>> pari.set_real_precision_bits(53) +>>> pari("sin(1)") +0.841470984807897 In the second case, the precision can be given as the argument ``precision`` in the function call, with a default of 53 bits. @@ -172,80 +175,44 @@ The real precision set by (but it still affects printing). As explained before, the precision increases to a multiple of the -wordsize. :: - - sage: a = pari(1).sin(precision=180); a - 0.841470984807897 - sage: a.bitprecision() - 192 - sage: b = pari(1).sin(precision=40); b - 0.841470984807897 - sage: b.bitprecision() - 64 - sage: c = pari(1).sin(); c - 0.841470984807897 - sage: c.bitprecision() - 64 - sage: pari.set_real_precision_bits(90) - sage: print(a); print(b); print(c) - 0.841470984807896506652502322 - 0.8414709848078965067 - 0.8414709848078965067 +wordsize. : + +>>> a = pari(1).sin(precision=180); a +0.841470984807897 +>>> a.bitprecision() +192 +>>> b = pari(1).sin(precision=40); b +0.841470984807897 +>>> b.bitprecision() +64 +>>> c = pari(1).sin(); c +0.841470984807897 +>>> c.bitprecision() +64 +>>> pari.set_real_precision_bits(90) +>>> print(a); print(b); print(c) +0.841470984807896506652502322 +0.8414709848078965067 +0.8414709848078965067 In the third case, the precision is determined only by the inexact -inputs and the ``precision`` argument is ignored:: - - sage: pari(1.0).sin(precision=180).bitprecision() - 64 - sage: pari(1.0).sin(precision=40).bitprecision() - 64 - sage: pari("1.0000000000000000000000000000000000000").sin().bitprecision() - 128 +inputs and the ``precision`` argument is ignored: -Elliptic curve functions ------------------------- +>>> pari(1.0).sin(precision=180).bitprecision() +64 +>>> pari(1.0).sin(precision=40).bitprecision() +64 +>>> pari("1.0000000000000000000000000000000000000").sin().bitprecision() +128 -An elliptic curve given with exact `a`-invariants is considered an -exact object. Therefore, you should set the precision for each method -call individually:: +Tests: - sage: e = pari([0,0,0,-82,0]).ellinit() - sage: eta1 = e.elleta(precision=100)[0] - sage: eta1.sage() - 3.6054636014326520859158205642077267748 - sage: eta1 = e.elleta(precision=180)[0] - sage: eta1.sage() - 3.60546360143265208591582056420772677481026899659802474544 +Check that output from PARI's print command is actually seen by +Sage (:trac:`9636`): -TESTS: +>>> pari('print("test")') +test -Check that output from PARI's print command is actually seen by -Sage (:trac:`9636`):: - - sage: pari('print("test")') - test - -Check that ``default()`` works properly:: - - sage: pari.default("debug") - 0 - sage: pari.default("debug", 3) - sage: pari(2**67+1).factor() - IFAC: cracking composite - 49191317529892137643 - IFAC: factor 6713103182899 - is prime - IFAC: factor 7327657 - is prime - IFAC: prime 7327657 - appears with exponent = 1 - IFAC: prime 6713103182899 - appears with exponent = 1 - IFAC: found 2 large prime (power) factors. - [3, 1; 7327657, 1; 6713103182899, 1] - sage: pari.default("debug", 0) - sage: pari(2**67+1).factor() - [3, 1; 7327657, 1; 6713103182899, 1] """ #***************************************************************************** @@ -285,20 +252,13 @@ def prec_bits_to_dec(long prec_in_bits): Convert from precision expressed in bits to precision expressed in decimal. - EXAMPLES:: + Examples: - sage: from sage.libs.cypari2.pari_instance import prec_bits_to_dec - sage: prec_bits_to_dec(53) - 15 - sage: [(32*n, prec_bits_to_dec(32*n)) for n in range(1, 9)] - [(32, 9), - (64, 19), - (96, 28), - (128, 38), - (160, 48), - (192, 57), - (224, 67), - (256, 77)] + >>> from cypari2.pari_instance import prec_bits_to_dec + >>> prec_bits_to_dec(53) + 15 + >>> [(32*n, prec_bits_to_dec(32*n)) for n in range(1, 9)] + [(32, 9), (64, 19), (96, 28), (128, 38), (160, 48), (192, 57), (224, 67), (256, 77)] """ return nbits2ndec(prec_in_bits) @@ -307,21 +267,13 @@ def prec_dec_to_bits(long prec_in_dec): Convert from precision expressed in decimal to precision expressed in bits. - EXAMPLES:: - - sage: from sage.libs.cypari2.pari_instance import prec_dec_to_bits - sage: prec_dec_to_bits(15) - 50 - sage: [(n, prec_dec_to_bits(n)) for n in range(10, 100, 10)] - [(10, 34), - (20, 67), - (30, 100), - (40, 133), - (50, 167), - (60, 200), - (70, 233), - (80, 266), - (90, 299)] + Examples: + + >>> from cypari2.pari_instance import prec_dec_to_bits + >>> prec_dec_to_bits(15) + 50 + >>> [(n, prec_dec_to_bits(n)) for n in range(10, 100, 10)] + [(10, 34), (20, 67), (30, 100), (40, 133), (50, 167), (60, 200), (70, 233), (80, 266), (90, 299)] """ cdef double log_10 = 3.32192809488736 return int(prec_in_dec*log_10 + 1.0) # Add one to round up @@ -333,18 +285,18 @@ cpdef long prec_bits_to_words(unsigned long prec_in_bits): adjusts for the two codewords of a pari real, and is architecture-dependent. - EXAMPLES:: - - sage: from sage.libs.cypari2.pari_instance import prec_bits_to_words - sage: prec_bits_to_words(70) - 5 # 32-bit - 4 # 64-bit + Examples: - :: + >>> from cypari2.pari_instance import prec_bits_to_words + >>> import sys + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> prec_bits_to_words(70) == (5 if bitness == '32' else 4) + True - sage: [(32*n, prec_bits_to_words(32*n)) for n in range(1, 9)] - [(32, 3), (64, 4), (96, 5), (128, 6), (160, 7), (192, 8), (224, 9), (256, 10)] # 32-bit - [(32, 3), (64, 3), (96, 4), (128, 4), (160, 5), (192, 5), (224, 6), (256, 6)] # 64-bit + >>> ans32 = [(32, 3), (64, 4), (96, 5), (128, 6), (160, 7), (192, 8), (224, 9), (256, 10)] + >>> ans64 = [(32, 3), (64, 3), (96, 4), (128, 4), (160, 5), (192, 5), (224, 6), (256, 6)] + >>> [(32*n, prec_bits_to_words(32*n)) for n in range(1, 9)] == (ans32 if bitness == '32' else ans64) + True """ if not prec_in_bits: return prec @@ -359,15 +311,18 @@ cpdef long prec_words_to_bits(long prec_in_words): expressed in bits. Note: this adjusts for the two codewords of a pari real, and is architecture-dependent. - EXAMPLES:: + Examples: - sage: from sage.libs.cypari2.pari_instance import prec_words_to_bits - sage: prec_words_to_bits(10) - 256 # 32-bit - 512 # 64-bit - sage: [(n, prec_words_to_bits(n)) for n in range(3, 10)] - [(3, 32), (4, 64), (5, 96), (6, 128), (7, 160), (8, 192), (9, 224)] # 32-bit - [(3, 64), (4, 128), (5, 192), (6, 256), (7, 320), (8, 384), (9, 448)] # 64-bit + >>> from cypari2.pari_instance import prec_words_to_bits + >>> import sys + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> prec_words_to_bits(10) == (256 if bitness == '32' else 512) + True + + >>> ans32 = [(3, 32), (4, 64), (5, 96), (6, 128), (7, 160), (8, 192), (9, 224)] + >>> ans64 = [(3, 64), (4, 128), (5, 192), (6, 256), (7, 320), (8, 384), (9, 448)] # 64-bit + >>> [(n, prec_words_to_bits(n)) for n in range(3, 10)] == (ans32 if bitness == '32' else ans64) + True """ # see user's guide to the pari library, page 10 return (prec_in_words - 2) * BITS_IN_LONG @@ -376,11 +331,11 @@ cpdef long default_bitprec(): r""" Return the default precision in bits. - EXAMPLES:: + Examples: - sage: from sage.libs.cypari2.pari_instance import default_bitprec - sage: default_bitprec() - 64 + >>> from cypari2.pari_instance import default_bitprec + >>> default_bitprec() + 64 """ return (prec - 2) * BITS_IN_LONG @@ -390,15 +345,18 @@ def prec_dec_to_words(long prec_in_dec): in words. Note: this rounds up to the nearest word, adjusts for the two codewords of a pari real, and is architecture-dependent. - EXAMPLES:: + Examples: + + >>> from cypari2.pari_instance import prec_dec_to_words + >>> import sys + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> prec_dec_to_words(38) == (6 if bitness == '32' else 4) + True - sage: from sage.libs.cypari2.pari_instance import prec_dec_to_words - sage: prec_dec_to_words(38) - 6 # 32-bit - 4 # 64-bit - sage: [(n, prec_dec_to_words(n)) for n in range(10, 90, 10)] - [(10, 4), (20, 5), (30, 6), (40, 7), (50, 8), (60, 9), (70, 10), (80, 11)] # 32-bit - [(10, 3), (20, 4), (30, 4), (40, 5), (50, 5), (60, 6), (70, 6), (80, 7)] # 64-bit + >>> ans32 = [(10, 4), (20, 5), (30, 6), (40, 7), (50, 8), (60, 9), (70, 10), (80, 11)] + >>> ans64 = [(10, 3), (20, 4), (30, 4), (40, 5), (50, 5), (60, 6), (70, 6), (80, 7)] # 64-bit + >>> [(n, prec_dec_to_words(n)) for n in range(10, 90, 10)] == (ans32 if bitness == '32' else ans64) + True """ return prec_bits_to_words(prec_dec_to_bits(prec_in_dec)) @@ -408,15 +366,18 @@ def prec_words_to_dec(long prec_in_words): decimal. Note: this adjusts for the two codewords of a pari real, and is architecture-dependent. - EXAMPLES:: + Examples: - sage: from sage.libs.cypari2.pari_instance import prec_words_to_dec - sage: prec_words_to_dec(5) - 28 # 32-bit - 57 # 64-bit - sage: [(n, prec_words_to_dec(n)) for n in range(3, 10)] - [(3, 9), (4, 19), (5, 28), (6, 38), (7, 48), (8, 57), (9, 67)] # 32-bit - [(3, 19), (4, 38), (5, 57), (6, 77), (7, 96), (8, 115), (9, 134)] # 64-bit + >>> from cypari2.pari_instance import prec_words_to_dec + >>> import sys + >>> bitness = '64' if sys.maxsize > (1 << 32) else '32' + >>> prec_words_to_dec(5) == (28 if bitness == '32' else 57) + True + + >>> ans32 = [(3, 9), (4, 19), (5, 28), (6, 38), (7, 48), (8, 57), (9, 67)] + >>> ans64 = [(3, 19), (4, 38), (5, 57), (6, 77), (7, 96), (8, 115), (9, 134)] + >>> [(n, prec_words_to_dec(n)) for n in range(3, 10)] == (ans32 if bitness == '32' else ans64) + True """ return prec_bits_to_dec(prec_words_to_bits(prec_in_words)) @@ -449,11 +410,11 @@ cdef class Pari(Pari_auto): r""" (Re)-initialize the PARI library. - TESTS:: + Tests: - sage: from sage.libs.cypari2.pari_instance import Pari - sage: Pari.__new__(Pari) - Interface to the PARI C library + >>> from cypari2.pari_instance import Pari + >>> Pari.__new__(Pari) + Interface to the PARI C library """ # PARI is already initialized, nothing to do... if avma: @@ -521,22 +482,23 @@ cdef class Pari(Pari_auto): of primes is only computed is ``maxprime`` is larger than the current bound. - EXAMPLES:: - - sage: from sage.libs.cypari2.pari_instance import Pari - sage: pari2 = Pari(10**7) - sage: pari2 - Interface to the PARI C library - sage: pari2 is pari - False - sage: pari2.PARI_ZERO == pari.PARI_ZERO - True - sage: pari2 = Pari(10**6) - sage: pari.stacksize(), pari2.stacksize() - (10000000, 10000000) + Examples: + + >>> from cypari2.pari_instance import Pari + >>> pari = Pari() + >>> pari2 = Pari(10**7) + >>> pari2 + Interface to the PARI C library + >>> pari2 is pari + False + >>> pari2.PARI_ZERO == pari.PARI_ZERO + True + >>> pari2 = Pari(10**6) + >>> pari.stacksize(), pari2.stacksize() + (10000000, 10000000) For more information about how precision works in the PARI - interface, see :mod:`sage.libs.cypari2.pari_instance`. + interface, see :mod:`cypari2.pari_instance`. .. NOTE:: @@ -586,14 +548,15 @@ cdef class Pari(Pari_auto): If you want to reallocate the PARI library again, construct a new instance of :class:`Pari`. - EXAMPLES:: + Examples: - sage: from sage.libs.cypari2.pari_instance import Pari - sage: pari2 = Pari(10**7) - sage: pari2._close() - sage: pari2 = Pari(10**6) - sage: pari.stacksize() - 1000000 + >>> from cypari2.pari_instance import Pari + >>> pari = Pari() + >>> pari2 = Pari(10**7) + >>> pari2._close() + >>> pari2 = Pari(10**6) + >>> pari.stacksize() + 1000000 .. WARNING:: @@ -617,13 +580,15 @@ cdef class Pari(Pari_auto): (available memory address, think of this as the stack pointer), ``bot`` (bottom of stack). - EXAMPLES:: + Examples: - sage: pari.debugstack() # random - top = 0x60b2c60 - avma = 0x5875c38 - bot = 0x57295e0 - size = 1000000 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.debugstack() # random + top = 0x60b2c60 + avma = 0x5875c38 + bot = 0x57295e0 + size = 1000000 """ # We deliberately use low-level functions to minimize the # chances that something goes wrong here (for example, if we @@ -668,12 +633,14 @@ cdef class Pari(Pari_auto): .. seealso:: :meth:`set_real_precision` to set the precision in decimal digits. - EXAMPLES:: + Examples: - sage: pari.set_real_precision_bits(200) - sage: pari('1.2') - 1.20000000000000000000000000000000000000000000000000000000000 - sage: pari.set_real_precision_bits(53) + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.set_real_precision_bits(200) + >>> pari('1.2') + 1.20000000000000000000000000000000000000000000000000000000000 + >>> pari.set_real_precision_bits(53) """ cdef bytes strn = str(n).encode("ascii") sig_on() @@ -695,10 +662,12 @@ cdef class Pari(Pari_auto): .. seealso:: :meth:`get_real_precision` to get the precision in decimal digits. - EXAMPLES:: + Examples: - sage: pari.get_real_precision_bits() - 53 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.get_real_precision_bits() + 53 """ cdef long r sig_on() @@ -722,14 +691,16 @@ cdef class Pari(Pari_auto): .. seealso:: :meth:`set_real_precision_bits` to set the precision in bits. - EXAMPLES:: + Examples: - sage: pari.set_real_precision(60) - 15 - sage: pari('1.2') - 1.20000000000000000000000000000000000000000000000000000000000 - sage: pari.set_real_precision(15) - 60 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.set_real_precision(60) + 15 + >>> pari('1.2') + 1.20000000000000000000000000000000000000000000000000000000000 + >>> pari.set_real_precision(15) + 60 """ old = self.get_real_precision() self.set_real_precision_bits(prec_dec_to_bits(n)) @@ -749,10 +720,12 @@ cdef class Pari(Pari_auto): .. seealso:: :meth:`get_real_precision_bits` to get the precision in bits. - EXAMPLES:: + Examples: - sage: pari.get_real_precision() - 15 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.get_real_precision() + 15 """ cdef long r sig_on() @@ -772,20 +745,24 @@ cdef class Pari(Pari_auto): Create a new Gen with the value of the double x, using Pari's dbltor. - EXAMPLES:: - - sage: pari.double_to_gen(1) - doctest:warning - ... - DeprecationWarning: pari.double_to_gen(x) is deprecated, use pari(x) instead - 1.00000000000000 - sage: pari.double_to_gen(1e30) - 1.00000000000000 E30 - sage: pari.double_to_gen(0) - 0.E-15 - sage: import math - sage: pari.double_to_gen(-math.sqrt(2)) - -1.41421356237310 + Examples: + + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> import warnings + >>> import math + >>> with warnings.catch_warnings(record=True) as w: + ... warnings.simplefilter('always') + ... pari.double_to_gen(1) + ... pari.double_to_gen(1e30) + ... pari.double_to_gen(0) + ... pari.double_to_gen(-math.sqrt(2)) + ... assert len(w) == 4 + ... assert all(issubclass(u.category, DeprecationWarning) for u in w) + 1.00000000000000 + 1.00000000000000 E30 + 0.E-15 + -1.41421356237310 """ # Deprecated in https://trac.sagemath.org/ticket/20241 from warnings import warn @@ -805,19 +782,19 @@ cdef class Pari(Pari_auto): """ Create the PARI object obtained by evaluating s using PARI. - EXAMPLES:: + Examples: - sage: pari(0) - 0 - sage: pari([2,3,5]) - [2, 3, 5] + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari(0) + 0 + >>> pari([2,3,5]) + [2, 3, 5] - :: - - sage: a = pari(1); a, a.type() - (1, 't_INT') - sage: a = pari(1/2); a, a.type() - (1/2, 't_FRAC') + >>> a = pari(1); a, a.type() + (1, 't_INT') + >>> a = pari('1/2'); a, a.type() + (1/2, 't_FRAC') See :func:`pari` for more examples. """ @@ -825,19 +802,23 @@ cdef class Pari(Pari_auto): cpdef Gen zero(self): """ - EXAMPLES:: + Examples: - sage: pari.zero() - 0 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.zero() + 0 """ return self.PARI_ZERO cpdef Gen one(self): """ - EXAMPLES:: + Examples: - sage: pari.one() - 1 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.one() + 1 """ return self.PARI_ONE @@ -872,13 +853,15 @@ cdef class Pari(Pari_auto): - :meth:`allocatemem` to change the current or maximum stack size - EXAMPLES:: + Examples: - sage: pari.stacksize() - 1000000 - sage: pari.allocatemem(2**18, silent=True) - sage: pari.stacksize() - 262144 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.stacksize() + 8000000 + >>> pari.allocatemem(2**18, silent=True) + >>> pari.stacksize() + 262144 """ return pari_mainstack.size @@ -895,11 +878,13 @@ cdef class Pari(Pari_auto): - :meth:`allocatemem` to change the current or maximum stack size - EXAMPLES:: + Examples: - sage: pari.allocatemem(2**18, 2**26, silent=True) - sage: pari.stacksizemax() - 67108864 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.allocatemem(2**18, 2**26, silent=True) + >>> pari.stacksizemax() + 67108864 """ return pari_mainstack.vsize @@ -934,56 +919,58 @@ cdef class Pari(Pari_auto): ``sizemax`` is 0, the maximum of the current maximum and ``s`` is taken. - EXAMPLES:: + Examples: - sage: pari.allocatemem(10**7) - PARI stack size set to 10000000 bytes, maximum size set to 67108864 - sage: pari.allocatemem() # Double the current size - PARI stack size set to 20000000 bytes, maximum size set to 67108864 - sage: pari.stacksize() - 20000000 - sage: pari.allocatemem(10**6) - PARI stack size set to 1000000 bytes, maximum size set to 67108864 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.allocatemem(10**7) + PARI stack size set to 10000000 bytes, maximum size set to 10002432 + >>> pari.allocatemem() # Double the current size + PARI stack size set to 20000000 bytes, maximum size set to 20000768 + >>> pari.stacksize() + 20000000 + >>> pari.allocatemem(10**6) + PARI stack size set to 1000000 bytes, maximum size set to 20000768 The following computation will automatically increase the PARI - stack size:: + stack size: - sage: a = pari('2^100000000') + >>> a = pari('2^100000000') ``a`` is now a Python variable on the Python heap and does not take up any space on the PARI stack. The PARI stack is still - large because of the computation of ``a``:: + large because of the computation of ``a``: - sage: pari.stacksize() # random - 12500264 + >>> pari.stacksize() > 10**6 + True - Setting a small maximum size makes this fail:: + Setting a small maximum size makes this fail: - sage: pari.allocatemem(10**6, 2**22) - PARI stack size set to 1000000 bytes, maximum size set to 4194304 - sage: a = pari('2^100000000') - Traceback (most recent call last): - ... - PariError: _^s: the PARI stack overflows (current size: 1000000; maximum size: 4194304) - You can use pari.allocatemem() to change the stack size and try again + >>> pari.allocatemem(10**6, 2**22) + PARI stack size set to 1000000 bytes, maximum size set to 4194304 + >>> a = pari('2^100000000') + Traceback (most recent call last): + ... + PariError: _^s: the PARI stack overflows (current size: 1000000; maximum size: 4194304) + You can use pari.allocatemem() to change the stack size and try again - TESTS: + Tests: Do the same without using the string interface and starting - from a very small stack size:: + from a very small stack size: - sage: pari.allocatemem(1, 2**26) - PARI stack size set to 1024 bytes, maximum size set to 67108864 - sage: a = pari(2)**100000000 - sage: pari.stacksize() # random - 12500024 + >>> pari.allocatemem(1, 2**26) + PARI stack size set to 1024 bytes, maximum size set to 67108864 + >>> a = pari(2)**100000000 + >>> pari.stacksize() > 10**6 + True - We do not allow ``sizemax`` less than ``s``:: + We do not allow ``sizemax`` less than ``s``: - sage: pari.allocatemem(10**7, 10**6) - Traceback (most recent call last): - ... - ValueError: the maximum size (10000000) should be at least the stack size (1000000) + >>> pari.allocatemem(10**7, 10**6) + Traceback (most recent call last): + ... + ValueError: the maximum size (10000000) should be at least the stack size (1000000) """ if s == 0: s = pari_mainstack.size * 2 @@ -1015,13 +1002,15 @@ cdef class Pari(Pari_auto): Recompute the primes table including at least all primes up to M (but possibly more). - EXAMPLES:: + Examples: - sage: pari.init_primes(200000) + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.init_primes(200000) We make sure that ticket :trac:`11741` has been fixed:: - sage: pari.init_primes(2**30) + >>> pari.init_primes(2**30) Traceback (most recent call last): ... ValueError: Cannot compute primes beyond 436273290 @@ -1061,37 +1050,39 @@ cdef class Pari(Pari_auto): OUTPUT: a PARI list of prime numbers - EXAMPLES:: - - sage: pari.primes(3) - [2, 3, 5] - sage: pari.primes(10) - [2, 3, 5, 7, 11, 13, 17, 19, 23, 29] - sage: pari.primes(20) - [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71] - sage: len(pari.primes(1000)) - 1000 - sage: pari.primes(11,29) - [11, 13, 17, 19, 23, 29] - sage: pari.primes((11,29)) - [11, 13, 17, 19, 23, 29] - sage: pari.primes(end=29) - [2, 3, 5, 7, 11, 13, 17, 19, 23, 29] - sage: pari.primes(10**30, 10**30 + 100) - [1000000000000000000000000000057, 1000000000000000000000000000099] - - TESTS:: - - sage: pari.primes(0) - [] - sage: pari.primes(-1) - [] - sage: pari.primes(end=1) - [] - sage: pari.primes(end=-1) - [] - sage: pari.primes(3,2) - [] + Examples: + + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.primes(3) + [2, 3, 5] + >>> pari.primes(10) + [2, 3, 5, 7, 11, 13, 17, 19, 23, 29] + >>> pari.primes(20) + [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71] + >>> len(pari.primes(1000)) + 1000 + >>> pari.primes(11,29) + [11, 13, 17, 19, 23, 29] + >>> pari.primes((11,29)) + [11, 13, 17, 19, 23, 29] + >>> pari.primes(end=29) + [2, 3, 5, 7, 11, 13, 17, 19, 23, 29] + >>> pari.primes(10**30, 10**30 + 100) + [1000000000000000000000000000057, 1000000000000000000000000000099] + + Tests: + + >>> pari.primes(0) + [] + >>> pari.primes(-1) + [] + >>> pari.primes(end=1) + [] + >>> pari.primes(end=-1) + [] + >>> pari.primes(3,2) + [] """ cdef Gen t0, t1 if end is None: @@ -1114,14 +1105,16 @@ cdef class Pari(Pari_auto): Chebyshev polynomial of the first kind of degree `n`, in the variable `v`. - EXAMPLES:: + Examples: - sage: pari.polchebyshev(7) - 64*x^7 - 112*x^5 + 56*x^3 - 7*x - sage: pari.polchebyshev(7, 'z') - 64*z^7 - 112*z^5 + 56*z^3 - 7*z - sage: pari.polchebyshev(0) - 1 + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.polchebyshev(7) + 64*x^7 - 112*x^5 + 56*x^3 - 7*x + >>> pari.polchebyshev(7, 'z') + 64*z^7 - 112*z^5 + 56*z^3 - 7*z + >>> pari.polchebyshev(0) + 1 """ sig_on() return new_gen(polchebyshev1(n, get_var(v))) @@ -1130,16 +1123,18 @@ cdef class Pari(Pari_auto): """ Return the factorial of the integer n as a PARI gen. - EXAMPLES:: - - sage: pari.factorial(0) - 1 - sage: pari.factorial(1) - 1 - sage: pari.factorial(5) - 120 - sage: pari.factorial(25) - 15511210043330985984000000 + Examples: + + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.factorial(0) + 1 + >>> pari.factorial(1) + 1 + >>> pari.factorial(5) + 120 + >>> pari.factorial(25) + 15511210043330985984000000 """ sig_on() return new_gen(mpfact(n)) @@ -1151,15 +1146,18 @@ cdef class Pari(Pari_auto): cyclotomic field `\QQ(\zeta_n)`, where `d` divides `\phi(n)`. - EXAMPLES:: + Examples:: - sage: pari.polsubcyclo(8, 4) + >>> import cypari2 + >>> pari = cypari2.Pari() + + >>> pari.polsubcyclo(8, 4) [x^4 + 1] - sage: pari.polsubcyclo(8, 2, 'z') + >>> pari.polsubcyclo(8, 2, 'z') [z^2 + 2, z^2 - 2, z^2 + 1] - sage: pari.polsubcyclo(8, 1) + >>> pari.polsubcyclo(8, 1) [x - 1] - sage: pari.polsubcyclo(8, 3) + >>> pari.polsubcyclo(8, 3) [] """ cdef Gen plist @@ -1183,22 +1181,24 @@ cdef class Pari(Pari_auto): random number seed handling in ``sage.misc.randstate`` and call ``current_randstate().set_seed_pari()``. - EXAMPLES:: + Examples: - sage: pari.setrand(50) - sage: a = pari.getrand() - sage: pari.setrand(a) - sage: a == pari.getrand() - True + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.setrand(50) + >>> a = pari.getrand() + >>> pari.setrand(a) + >>> a == pari.getrand() + True - TESTS: + Tests: - Check that invalid inputs are handled properly (:trac:`11825`):: + Check that invalid inputs are handled properly: - sage: pari.setrand("foobar") - Traceback (most recent call last): - ... - PariError: incorrect type in setrand (t_POL) + >>> pari.setrand("foobar") + Traceback (most recent call last): + ... + PariError: incorrect type in setrand (t_POL) """ cdef Gen t0 = self(seed) sig_on() @@ -1210,16 +1210,18 @@ cdef class Pari(Pari_auto): vector(long n, entries=None): Create and return the length n PARI vector with given list of entries. - EXAMPLES:: + Examples: - sage: pari.vector(5, [1, 2, 5, 4, 3]) - [1, 2, 5, 4, 3] - sage: pari.vector(2, [x, 1]) - [x, 1] - sage: pari.vector(2, [x, 1, 5]) - Traceback (most recent call last): - ... - IndexError: length of entries (=3) must equal n (=2) + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.vector(5, [1, 2, 5, 4, 3]) + [1, 2, 5, 4, 3] + >>> pari.vector(2, ['x', 1]) + [x, 1] + >>> pari.vector(2, ['x', 1, 5]) + Traceback (most recent call last): + ... + IndexError: length of entries (=3) must equal n (=2) """ cdef Gen v = self._empty_vector(n) if entries is not None: @@ -1241,10 +1243,12 @@ cdef class Pari(Pari_auto): matrix(long m, long n, entries=None): Create and return the m x n PARI matrix with given list of entries. - EXAMPLES:: + Examples: - sage: pari.matrix(3,3,range(9)) - [0, 1, 2; 3, 4, 5; 6, 7, 8] + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.matrix(3,3,range(9)) + [0, 1, 2; 3, 4, 5; 6, 7, 8] """ cdef long i, j, k cdef Gen A @@ -1274,11 +1278,13 @@ cdef class Pari(Pari_auto): the polynomials `P` and `Q` have integer coefficients, to represent the model `y^2 + Q(x)y = P(x)`. - EXAMPLES:: + Examples: - sage: x = pari('x') - sage: pari.genus2red([-5*x**5, x**3 - 2*x**2 - 2*x + 1]) - [1416875, [2, -1; 5, 4; 2267, 1], x^6 - 240*x^4 - 2550*x^3 - 11400*x^2 - 24100*x - 19855, [[2, [2, [Mod(1, 2)]], []], [5, [1, []], ["[V] page 156", [3]]], [2267, [2, [Mod(432, 2267)]], ["[I{1-0-0}] page 170", []]]]] + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> x = pari('x') + >>> pari.genus2red([-5*x**5, x**3 - 2*x**2 - 2*x + 1]) + [1416875, [2, -1; 5, 4; 2267, 1], x^6 - 240*x^4 - 2550*x^3 - 11400*x^2 - 24100*x - 19855, [[2, [2, [Mod(1, 2)]], []], [5, [1, []], ["[V] page 156", [3]]], [2267, [2, [Mod(432, 2267)]], ["[I{1-0-0}] page 170", []]]]] """ cdef Gen t0 = objtogen(P) sig_on() @@ -1288,21 +1294,23 @@ cdef class Pari(Pari_auto): """ Create an empty list or convert `x` to a list. - EXAMPLES:: - - sage: pari.List(range(5)) - List([0, 1, 2, 3, 4]) - sage: L = pari.List() - sage: L - List([]) - sage: L.listput(42, 1) - 42 - sage: L - List([42]) - sage: L.listinsert(24, 1) - 24 - sage: L - List([24, 42]) + Examples:: + + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari.List(range(5)) + List([0, 1, 2, 3, 4]) + >>> L = pari.List() + >>> L + List([]) + >>> L.listput(42, 1) + 42 + >>> L + List([42]) + >>> L.listinsert(24, 1) + 24 + >>> L + List([24, 42]) """ if x is None: sig_on() @@ -1331,32 +1339,34 @@ cdef long get_var(v) except -2: you want variable names which cannot be confused with ordinary user variables. - EXAMPLES: + Examples: - We test this function using ``Pol()`` which calls this function:: + We test this function using ``Pol()`` which calls this function: - sage: pari("[1,0]").Pol() - x - sage: pari("[2,0]").Pol('x') - 2*x - sage: pari("[Pi,0]").Pol('!@#$%^&') - 3.14159265358979*!@#$%^& + >>> import cypari2 + >>> pari = cypari2.Pari() + >>> pari("[1,0]").Pol() + x + >>> pari("[2,0]").Pol('x') + 2*x + >>> pari("[Pi,0]").Pol('!@#$%^&') + 3.14159265358979*!@#$%^& We can use ``varhigher()`` and ``varlower()`` to create temporary variables without a name. The ``"xx"`` below is just a string to display the variable, it doesn't create a variable - ``"xx"``:: + ``"xx"``: - sage: xx = pari.varhigher("xx") - sage: pari("[x,0]").Pol(xx) - x*xx + >>> xx = pari.varhigher("xx") + >>> pari("[x,0]").Pol(xx) + x*xx - Indeed, this is not the same as:: + Indeed, this is not the same as: - sage: pari("[x,0]").Pol("xx") - Traceback (most recent call last): - ... - PariError: incorrect priority in gtopoly: variable x <= xx + >>> pari("[x,0]").Pol("xx") + Traceback (most recent call last): + ... + PariError: incorrect priority in gtopoly: variable x <= xx """ if v is None: return -1